Difference between revisions of "RXN-16624"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7088 CPD-7088] == * smiles: ** C3(C(C2(OC1(=CC(=CC(=C1C(C2O)O)O)O)))=CC(O)=C(C(O)=3)O) * in...") |
(Created page with "Category:Gene == Gene Ec-19_003170 == * left end position: ** 3436300 * transcription direction: ** NEGATIVE * right end position: ** 3447975 * centisome position: ** 57.5...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-19_003170 == |
− | * | + | * left end position: |
− | ** | + | ** 3436300 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 3447975 |
− | * | + | * centisome position: |
− | ** | + | ** 57.552834 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0367_0011 |
− | ** | + | ** Esi0367_0011 |
− | == | + | == Reactions associated == |
− | + | * [[5.3.4.1-RXN]] | |
− | * [[RXN- | + | ** esiliculosus_genome |
− | == | + | ***go-term |
+ | * [[DISULISOM-RXN]] | ||
+ | ** esiliculosus_genome | ||
+ | ***go-term | ||
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=3436300}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=3447975}} | |
− | + | {{#set: centisome position=57.552834 }} | |
− | + | {{#set: common name=Esi_0367_0011|Esi0367_0011}} | |
− | + | {{#set: reaction associated=5.3.4.1-RXN|DISULISOM-RXN}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 21:31, 17 March 2018
Gene Ec-19_003170
- left end position:
- 3436300
- transcription direction:
- NEGATIVE
- right end position:
- 3447975
- centisome position:
- 57.552834
- Synonym(s):
- Esi_0367_0011
- Esi0367_0011
Reactions associated
- 5.3.4.1-RXN
- esiliculosus_genome
- go-term
- esiliculosus_genome
- DISULISOM-RXN
- esiliculosus_genome
- go-term
- esiliculosus_genome