Difference between revisions of "DIMETHYL-D-RIBITYL-LUMAZINE"

Revision as of 21:31, 17 March 2018

"C(=O)([O-])OP([O-])(=O)O" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
-[[Category:Gene]]
+[[Category:Metabolite]]
-== Gene Ec-07_006910 ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18238 CPD-18238] ==
-* left end position:
+* smiles:
-** 6597793
+** C(=O)([O-])OP([O-])(=O)O
-* transcription direction:
+* inchi key:
-** POSITIVE
+** InChIKey=LQQCGEGRINLHDP-UHFFFAOYSA-L
-* right end position:
+* common name:
-** 6606891
+** carboxyphosphate
-* centisome position:
+* molecular weight:
-** 85.43675
+** 139.989
 * Synonym(s):
-** Esi_0111_0016
-** Esi0111_0016
-** MPP
-== Reactions associated ==
+== Reaction(s) known to consume the compound ==
-* [[3.4.24.64-RXN]]
+* [[RXN-16910]]
-** esiliculosus_genome
+== Reaction(s) known to produce the compound ==
-***automated-name-match
+* [[RXN-16909]]
-== Pathways associated ==
+== Reaction(s) of unknown directionality ==
 == External links  ==
-{{#set: left end position=6597793}}
+* CHEMSPIDER:
-{{#set: transcription direction=POSITIVE}}
+** [http://www.chemspider.com/Chemical-Structure.169776.html 169776]
-{{#set: right end position=6606891}}
+{{#set: smiles=C(=O)([O-])OP([O-])(=O)O}}
-{{#set: centisome position=85.43675    }}
+{{#set: inchi key=InChIKey=LQQCGEGRINLHDP-UHFFFAOYSA-L}}
-{{#set: common name=Esi_0111_0016|Esi0111_0016|MPP}}
+{{#set: common name=carboxyphosphate}}
-{{#set: reaction associated=3.4.24.64-RXN}}
+{{#set: molecular weight=139.989    }}
+{{#set: consumed by=RXN-16910}}
+{{#set: produced by=RXN-16909}}