Difference between revisions of "FARNESYLTRANSTRANSFERASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1G-0 CPD1G-0] == * smiles: ** C(O)C2(C(C(C([N+])C(OC1(C(O)C(O)C(O)C(O)C(O)1))O2)O)O) * inchi...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-DEHYDRO-ASCORBATE L-DEHYDRO-ASCORBATE] == * smiles: ** C(O)C(O)C1(C(=O)C(=O)C(=O)O1) * inchi...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-DEHYDRO-ASCORBATE L-DEHYDRO-ASCORBATE] == |
* smiles: | * smiles: | ||
| − | ** C(O) | + | ** C(O)C(O)C1(C(=O)C(=O)C(=O)O1) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=SBJKKFFYIZUCET-SZSCBOSDSA-N |
* common name: | * common name: | ||
| − | ** | + | ** L-dehydro-ascorbate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 174.11 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** dehydroascorbate |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-12862]] |
| + | * [[RXN-12869]] | ||
| + | * [[1.8.5.1-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[DOPAMINE-BETA-MONOOXYGENASE-RXN]] | ||
| + | * [[RXN-3523]] | ||
| + | * [[RXN-12440]] | ||
| + | * [[RXN-12876]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05422 C05422] |
| − | * HMDB : | + | * CHEBI: |
| − | {{#set: smiles=C(O) | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58070 58070] |
| − | {{#set: inchi key=InChIKey= | + | * METABOLIGHTS : MTBLC58070 |
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: molecular weight= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15558810 15558810] |
| − | {{#set: common name= | + | * HMDB : HMDB01264 |
| − | {{#set: | + | {{#set: smiles=C(O)C(O)C1(C(=O)C(=O)C(=O)O1)}} |
| + | {{#set: inchi key=InChIKey=SBJKKFFYIZUCET-SZSCBOSDSA-N}} | ||
| + | {{#set: common name=L-dehydro-ascorbate}} | ||
| + | {{#set: molecular weight=174.11 }} | ||
| + | {{#set: common name=dehydroascorbate}} | ||
| + | {{#set: consumed by=RXN-12862|RXN-12869|1.8.5.1-RXN}} | ||
| + | {{#set: produced by=DOPAMINE-BETA-MONOOXYGENASE-RXN|RXN-3523|RXN-12440|RXN-12876}} | ||
Revision as of 21:31, 17 March 2018
Contents
Metabolite L-DEHYDRO-ASCORBATE
- smiles:
- C(O)C(O)C1(C(=O)C(=O)C(=O)O1)
- inchi key:
- InChIKey=SBJKKFFYIZUCET-SZSCBOSDSA-N
- common name:
- L-dehydro-ascorbate
- molecular weight:
- 174.11
- Synonym(s):
- dehydroascorbate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
