Difference between revisions of "RXN0-5257"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-01_000130 == * left end position: ** 79243 * transcription direction: ** NEGATIVE * right end position: ** 82180 * centisome position: ** 0.767945...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9925 CPD-9925] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C2(C=C(O)C1(=CC=CC=C1C(O)=2)))=...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9925 CPD-9925] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C2(C=C(O)C1(=CC=CC=C1C(O)=2)))=O)COP(=O)(OP(=O)(OCC3(C(OP([O-])(=O)[O-])C(O)C(O3)N5(C4(=C(C(N)=NC=N4)N=C5))))[O-])[O-] |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=PYTINLGPKDJURZ-HSJNEKGZSA-J |
| − | * | + | * common name: |
| − | ** | + | ** 1,4-dihydroxy-2-naphthoyl-CoA |
| − | * | + | * molecular weight: |
| − | ** | + | ** 949.669 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 1,4-dihydroxy-2-naphthoate-CoA |
| − | ** | + | ** DHNA-CoA |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[NAPHTHOATE-SYN-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878473 46878473] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58897 58897] |
| − | {{#set: common name= | + | * LIGAND-CPD: |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15547 C15547] | |
| − | {{#set: | + | {{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C2(C=C(O)C1(=CC=CC=C1C(O)=2)))=O)COP(=O)(OP(=O)(OCC3(C(OP([O-])(=O)[O-])C(O)C(O3)N5(C4(=C(C(N)=NC=N4)N=C5))))[O-])[O-]}} |
| + | {{#set: inchi key=InChIKey=PYTINLGPKDJURZ-HSJNEKGZSA-J}} | ||
| + | {{#set: common name=1,4-dihydroxy-2-naphthoyl-CoA}} | ||
| + | {{#set: molecular weight=949.669 }} | ||
| + | {{#set: common name=1,4-dihydroxy-2-naphthoate-CoA|DHNA-CoA}} | ||
| + | {{#set: produced by=NAPHTHOATE-SYN-RXN}} | ||
Revision as of 21:32, 17 March 2018
Contents
Metabolite CPD-9925
- smiles:
- CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C2(C=C(O)C1(=CC=CC=C1C(O)=2)))=O)COP(=O)(OP(=O)(OCC3(C(OP([O-])(=O)[O-])C(O)C(O3)N5(C4(=C(C(N)=NC=N4)N=C5))))[O-])[O-]
- inchi key:
- InChIKey=PYTINLGPKDJURZ-HSJNEKGZSA-J
- common name:
- 1,4-dihydroxy-2-naphthoyl-CoA
- molecular weight:
- 949.669
- Synonym(s):
- 1,4-dihydroxy-2-naphthoate-CoA
- DHNA-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C2(C=C(O)C1(=CC=CC=C1C(O)=2)))=O)COP(=O)(OP(=O)(OCC3(C(OP([O-])(=O)[O-])C(O)C(O3)N5(C4(=C(C(N)=NC=N4)N=C5))))[O-])[O-" cannot be used as a page name in this wiki.
