Difference between revisions of "SINAPALDEHYDE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2106 CPD0-2106] == * smiles: ** CCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)...")
 
(Created page with "Category:Gene == Gene Ec-26_005440 == * left end position: ** 5620994 * transcription direction: ** POSITIVE * right end position: ** 5631407 * centisome position: ** 85.3...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2106 CPD0-2106] ==
+
== Gene Ec-26_005440 ==
−
* smiles:
+
* left end position:
−
** CCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 5620994
−
* inchi key:
+
* transcription direction:
−
** InChIKey=WPIVBCGRGVNDDT-CECATXLMSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 3-oxooctanoyl-CoA
+
** 5631407
−
* molecular weight:
+
* centisome position:
−
** 903.684    
+
** 85.381996    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0059_0137
 +
** Esi0059_0137
 +
** IPS
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[MYO-INOSITOL-1-PHOSPHATE-SYNTHASE-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** esiliculosus_genome
−
* [[RXN-14277]]
+
***ec-number
 +
* [[RXN66-579]]
 +
** esiliculosus_genome
 +
***ec-number
 +
== Pathways associated ==
 +
* [[PWY-2301]]
 +
* [[PWY-4661]]
 +
* [[PWY-6580]]
 +
* [[PWY-6664]]
 +
* [[PWY1G-0]]
 +
* [[PWY-6372]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: left end position=5620994}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05267 C05267]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=5631407}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62619 62619]
+
{{#set: centisome position=85.381996    }}
−
* BIGG : 45463
+
{{#set: common name=Esi_0059_0137|Esi0059_0137|IPS}}
−
* PUBCHEM:
+
{{#set: reaction associated=MYO-INOSITOL-1-PHOSPHATE-SYNTHASE-RXN|RXN66-579}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173417 46173417]
+
{{#set: pathway associated=PWY-2301|PWY-4661|PWY-6580|PWY-6664|PWY1G-0|PWY-6372}}
−
* HMDB : HMDB03941
+
−
{{#set: smiles=CCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=WPIVBCGRGVNDDT-CECATXLMSA-J}}
+
−
{{#set: common name=3-oxooctanoyl-CoA}}
+
−
{{#set: molecular weight=903.684    }}
+
−
{{#set: consumed or produced by=RXN-14277}}
+

Revision as of 21:32, 17 March 2018

Gene Ec-26_005440

  • left end position:
    • 5620994
  • transcription direction:
    • POSITIVE
  • right end position:
    • 5631407
  • centisome position:
    • 85.381996
  • Synonym(s):
    • Esi_0059_0137
    • Esi0059_0137
    • IPS

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=SINAPALDEHYDE&oldid=13429"