Difference between revisions of "SULFITE-REDUCTASE-FERREDOXIN-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NICOTINE NICOTINE] == * smiles: ** C1(CC[CH]([N+](C)1)C2(C=NC=CC=2)) * inchi key: ** InChIKey=S...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9515 RXN-9515] == * direction: ** LEFT-TO-RIGHT * common name: ** crotonyl-[acyl-carrier protei...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NICOTINE NICOTINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9515 RXN-9515] ==
−
* smiles:
+
* direction:
−
** C1(CC[CH]([N+](C)1)C2(C=NC=CC=2))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=SNICXCGAKADSCV-JTQLQIEISA-O
+
 
* common name:
 
* common name:
−
** (S)-nicotine
+
** crotonyl-[acyl-carrier protein] reductase (NADP)
−
* molecular weight:
+
* ec number:
−
** 163.242   
+
** [http://enzyme.expasy.org/EC/1.3.1.10 EC-1.3.1.10]
 +
** [http://enzyme.expasy.org/EC/1.3.1.39 EC-1.3.1.39]
 +
** [http://enzyme.expasy.org/EC/2.3.1.85 EC-2.3.1.85]
 +
** [http://enzyme.expasy.org/EC/2.3.1.86 EC-2.3.1.86]
 
* Synonym(s):
 
* Synonym(s):
−
** nicotine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN66-81]]
+
* With identifiers:
−
* [[RXN66-146]]
+
** 1 [[PROTON]][c] '''+''' 1 [[Crotonyl-ACPs]][c] '''+''' 1 [[NADPH]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[Butanoyl-ACPs]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 H+[c] '''+''' 1 a crotonyl-[acp][c] '''+''' 1 NADPH[c] '''=>''' 1 NADP+[c] '''+''' 1 a butyryl-[acp][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-5994]], palmitate biosynthesis I (animals and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5994 PWY-5994]
 +
** '''20''' reactions found over '''31''' reactions in the full pathway
 +
* [[PWY-7388]], octanoyl-[acyl-carrier protein] biosynthesis (mitochondria, yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7388 PWY-7388]
 +
** '''9''' reactions found over '''9''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* NCI:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=5065 5065]
+
{{#set: common name=crotonyl-[acyl-carrier protein] reductase (NADP)}}
−
* PUBCHEM:
+
{{#set: ec number=EC-1.3.1.10}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6919000 6919000]
+
{{#set: ec number=EC-1.3.1.39}}
−
* HMDB : HMDB01934
+
{{#set: ec number=EC-2.3.1.85}}
−
* LIGAND-CPD:
+
{{#set: ec number=EC-2.3.1.86}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00745 C00745]
+
{{#set: in pathway=PWY-5994|PWY-7388}}
−
* CHEMSPIDER:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.chemspider.com/Chemical-Structure.5294163.html 5294163]
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
* CHEBI:
+
{{#set: reconstruction tool=pathwaytools}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=59806 59806]
+
−
{{#set: smiles=C1(CC[CH]([N+](C)1)C2(C=NC=CC=2))}}
+
−
{{#set: inchi key=InChIKey=SNICXCGAKADSCV-JTQLQIEISA-O}}
+
−
{{#set: common name=(S)-nicotine}}
+
−
{{#set: molecular weight=163.242    }}
+
−
{{#set: common name=nicotine}}
+
−
{{#set: consumed by=RXN66-81|RXN66-146}}
+

Revision as of 21:33, 17 March 2018

Reaction RXN-9515

Reaction Formula

Genes associated with this reaction

Pathways

  • PWY-5994, palmitate biosynthesis I (animals and fungi): PWY-5994
    • 20 reactions found over 31 reactions in the full pathway
  • PWY-7388, octanoyl-[acyl-carrier protein] biosynthesis (mitochondria, yeast): PWY-7388
    • 9 reactions found over 9 reactions in the full pathway

Reconstruction information

External links

"crotonyl-[acyl-carrier protein] reductase (NADP)" cannot be used as a page name in this wiki.





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=SULFITE-REDUCTASE-FERREDOXIN-RXN&oldid=13494"