Difference between revisions of "CPD-195"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-21_003700 == * left end position: ** 4682340 * transcription direction: ** POSITIVE * right end position: ** 4684239 * centisome position: ** 63.4...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FMNH2 FMNH2] == * smiles: ** CC2(=CC1(NC3(C(=O)NC(=O)NC(N(CC(O)C(O)C(O)COP([O-])(=O)[O-])C=1C=C...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FMNH2 FMNH2] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC2(=CC1(NC3(C(=O)NC(=O)NC(N(CC(O)C(O)C(O)COP([O-])(=O)[O-])C=1C=C(C)2)=3))) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=YTNIXZGTHTVJBW-SCRDCRAPSA-L |
| − | * | + | * common name: |
| − | ** | + | ** FMNH2 |
| − | * | + | * molecular weight: |
| − | ** | + | ** 456.348 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** Reduced FMN |
| − | ** | + | ** reduced flavin mononucleotide |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-9510]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 5666-16-0 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229161 44229161] |
| − | {{#set: | + | * HMDB : HMDB01142 |
| − | {{#set: common name= | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01847 C01847] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57618 57618] | ||
| + | * BIGG : 1489679 | ||
| + | {{#set: smiles=CC2(=CC1(NC3(C(=O)NC(=O)NC(N(CC(O)C(O)C(O)COP([O-])(=O)[O-])C=1C=C(C)2)=3)))}} | ||
| + | {{#set: inchi key=InChIKey=YTNIXZGTHTVJBW-SCRDCRAPSA-L}} | ||
| + | {{#set: common name=FMNH2}} | ||
| + | {{#set: molecular weight=456.348 }} | ||
| + | {{#set: common name=Reduced FMN|reduced flavin mononucleotide}} | ||
| + | {{#set: produced by=RXN-9510}} | ||
Revision as of 21:34, 17 March 2018
Contents
Metabolite FMNH2
- smiles:
- CC2(=CC1(NC3(C(=O)NC(=O)NC(N(CC(O)C(O)C(O)COP([O-])(=O)[O-])C=1C=C(C)2)=3)))
- inchi key:
- InChIKey=YTNIXZGTHTVJBW-SCRDCRAPSA-L
- common name:
- FMNH2
- molecular weight:
- 456.348
- Synonym(s):
- Reduced FMN
- reduced flavin mononucleotide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC2(=CC1(NC3(C(=O)NC(=O)NC(N(CC(O)C(O)C(O)COP([O-])(=O)[O-])C=1C=C(C)2)=3)))" cannot be used as a page name in this wiki.
