Difference between revisions of "FMNH2"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ARACHIDONIC_ACID ARACHIDONIC_ACID] == * smiles: ** CCCCCC=CCC=CCC=CCC=CCCCC(=O)[O-] * common na...") |
(Created page with "Category:Gene == Gene Ec-21_001480 == * left end position: ** 2440682 * transcription direction: ** POSITIVE * right end position: ** 2451212 * centisome position: ** 33.0...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-21_001480 == |
− | * | + | * left end position: |
− | ** | + | ** 2440682 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 2451212 |
− | * | + | * centisome position: |
− | ** | + | ** 33.071037 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0025_0138 |
− | ** | + | ** Esi0025_0138 |
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | + | * [[2.4.1.221-RXN]] | |
− | * [[ | + | ** esiliculosus_genome |
− | == | + | ***automated-name-match |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2440682}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=2451212}} | |
− | + | {{#set: centisome position=33.071037 }} | |
− | + | {{#set: common name=Esi_0025_0138|Esi0025_0138}} | |
− | + | {{#set: reaction associated=2.4.1.221-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 21:35, 17 March 2018
Gene Ec-21_001480
- left end position:
- 2440682
- transcription direction:
- POSITIVE
- right end position:
- 2451212
- centisome position:
- 33.071037
- Synonym(s):
- Esi_0025_0138
- Esi0025_0138
Reactions associated
- 2.4.1.221-RXN
- esiliculosus_genome
- automated-name-match
- esiliculosus_genome