Difference between revisions of "CPD1F-126"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-18_003520 == * left end position: ** 3509889 * transcription direction: ** NEGATIVE * right end position: ** 3514577 * centisome position: ** 71.2...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12653 CPD-12653] == * smiles: ** CCC=CCC=CCC=CCC=CCCCCC(=O)[O-] * common name: ** stearidon...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12653 CPD-12653] == |
− | * | + | * smiles: |
− | ** | + | ** CCC=CCC=CCC=CCC=CCCCCC(=O)[O-] |
− | * | + | * common name: |
− | ** | + | ** stearidonate |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=JIWBIWFOSCKQMA-LTKCOYKYSA-M |
− | * | + | * molecular weight: |
− | ** | + | ** 275.41 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** (6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoate |
− | ** | + | ** ((6Z,9Z,12Z,15Z)-octadecatetraenoate |
− | ** | + | ** all-cis-octadeca-6,9,12,15-tetraenoic acid |
+ | ** (6Z,9Z,12Z,15Z)-octadecatetraenoic acid | ||
+ | ** octadecatetraenoate | ||
+ | ** stearidonic acid | ||
+ | ** octadecatetraenoic acid | ||
+ | ** cis-6,9,12,15-octadecatetraenoate | ||
+ | ** 6,9,12,15-(Z,Z,Z,Z)-octadecatetraenoic acid | ||
+ | ** cis-6,9,12,15-octadecatetraenoic acid | ||
+ | ** (6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoic acid | ||
+ | ** moroctic acid | ||
+ | ** moroctate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-8349_PLANTCYC]] | |
− | + | * [[R07861]] | |
− | + | ||
− | * [[ | + | |
== External links == | == External links == | ||
− | {{#set: | + | * Wikipedia : Stearidonic_acid |
− | {{#set: | + | * HMDB : HMDB06547 |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77222 77222] |
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: reaction associated= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245840 25245840] |
− | + | * LIGAND-CPD: | |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C16300 C16300] | ||
+ | {{#set: smiles=CCC=CCC=CCC=CCC=CCCCCC(=O)[O-]}} | ||
+ | {{#set: common name=stearidonate}} | ||
+ | {{#set: inchi key=InChIKey=JIWBIWFOSCKQMA-LTKCOYKYSA-M}} | ||
+ | {{#set: molecular weight=275.41 }} | ||
+ | {{#set: common name=(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoate|((6Z,9Z,12Z,15Z)-octadecatetraenoate|all-cis-octadeca-6,9,12,15-tetraenoic acid|(6Z,9Z,12Z,15Z)-octadecatetraenoic acid|octadecatetraenoate|stearidonic acid|octadecatetraenoic acid|cis-6,9,12,15-octadecatetraenoate|6,9,12,15-(Z,Z,Z,Z)-octadecatetraenoic acid|cis-6,9,12,15-octadecatetraenoic acid|(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoic acid|moroctic acid|moroctate}} | ||
+ | {{#set: reversible reaction associated=RXN-8349_PLANTCYC|R07861}} |
Revision as of 21:35, 17 March 2018
Contents
Metabolite CPD-12653
- smiles:
- CCC=CCC=CCC=CCC=CCCCCC(=O)[O-]
- common name:
- stearidonate
- inchi key:
- InChIKey=JIWBIWFOSCKQMA-LTKCOYKYSA-M
- molecular weight:
- 275.41
- Synonym(s):
- (6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoate
- ((6Z,9Z,12Z,15Z)-octadecatetraenoate
- all-cis-octadeca-6,9,12,15-tetraenoic acid
- (6Z,9Z,12Z,15Z)-octadecatetraenoic acid
- octadecatetraenoate
- stearidonic acid
- octadecatetraenoic acid
- cis-6,9,12,15-octadecatetraenoate
- 6,9,12,15-(Z,Z,Z,Z)-octadecatetraenoic acid
- cis-6,9,12,15-octadecatetraenoic acid
- (6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoic acid
- moroctic acid
- moroctate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC=CCC=CCC=CCC=CCCCCC(=O)[O-" cannot be used as a page name in this wiki.