Difference between revisions of "Ec-07 007360"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-00_002760 == * left end position: ** 2926803 * transcription direction: ** POSITIVE * right end position: ** 2928633 * centisome position: ** 15.4...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3OH-4P-OH-ALPHA-KETOBUTYRATE 3OH-4P-OH-ALPHA-KETOBUTYRATE] == * smiles: ** C(C(C(C([O-])=O)=O)O...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3OH-4P-OH-ALPHA-KETOBUTYRATE 3OH-4P-OH-ALPHA-KETOBUTYRATE] == |
− | * | + | * smiles: |
− | ** | + | ** C(C(C(C([O-])=O)=O)O)OP([O-])(=O)[O-] |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=MZJFVXDTNBHTKZ-UWTATZPHSA-K |
− | * | + | * common name: |
− | ** | + | ** (3R)-3-hydroxy-2-oxo-4 phosphonooxybutanoate |
− | * | + | * molecular weight: |
− | ** | + | ** 211.045 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 3-hydroxy-4-phospho-hydroxy-α-ketobutyrate |
− | ** | + | ** 2-oxo-3-hydroxy-4-phosphobutanoate |
− | + | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[PSERTRANSAMPYR-RXN]] | |
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06054 C06054] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58538 58538] |
− | {{#set: common name= | + | * BIGG : 1447403 |
− | + | * PUBCHEM: | |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266680 45266680] |
+ | * HMDB : HMDB06801 | ||
+ | {{#set: smiles=C(C(C(C([O-])=O)=O)O)OP([O-])(=O)[O-]}} | ||
+ | {{#set: inchi key=InChIKey=MZJFVXDTNBHTKZ-UWTATZPHSA-K}} | ||
+ | {{#set: common name=(3R)-3-hydroxy-2-oxo-4 phosphonooxybutanoate}} | ||
+ | {{#set: molecular weight=211.045 }} | ||
+ | {{#set: common name=3-hydroxy-4-phospho-hydroxy-α-ketobutyrate|2-oxo-3-hydroxy-4-phosphobutanoate}} | ||
+ | {{#set: reversible reaction associated=PSERTRANSAMPYR-RXN}} |
Revision as of 22:36, 17 March 2018
Contents
Metabolite 3OH-4P-OH-ALPHA-KETOBUTYRATE
- smiles:
- C(C(C(C([O-])=O)=O)O)OP([O-])(=O)[O-]
- inchi key:
- InChIKey=MZJFVXDTNBHTKZ-UWTATZPHSA-K
- common name:
- (3R)-3-hydroxy-2-oxo-4 phosphonooxybutanoate
- molecular weight:
- 211.045
- Synonym(s):
- 3-hydroxy-4-phospho-hydroxy-α-ketobutyrate
- 2-oxo-3-hydroxy-4-phosphobutanoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C(C(C([O-])=O)=O)O)OP([O-])(=O)[O-" cannot be used as a page name in this wiki.