Difference between revisions of "CPD-4203"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-CTP 5-HYDROXY-CTP] == * smiles: ** C(C2(C(C(O)C(N1(C(N=C(C(O)=C1)N)=O))O2)O))OP(OP(OP...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UNDECAPRENYL-DIPHOSPHATE UNDECAPRENYL-DIPHOSPHATE] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(C)=CCCC...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UNDECAPRENYL-DIPHOSPHATE UNDECAPRENYL-DIPHOSPHATE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP([O-])(=O)OP(=O)([O-])[O-])C)C)C |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=NTXGVHCCXVHYCL-NTDVEAECSA-K |
* common name: | * common name: | ||
| − | ** | + | ** di-trans,octa-cis-undecaprenyl diphosphate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 924.251 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** di-trans-poly-cis-undecaprenyl diphosphate |
| + | ** undecaprenyl-PP (ambiguous) | ||
| + | ** bactoprenyl pyrophosphate | ||
| + | ** undecaprenyl pyrophosphate (ambiguous) | ||
| + | ** UPP (ambiguous) | ||
| + | ** di-trans,octa-cis-undecaprenyl diphosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-8999]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245563 25245563] |
| − | {{#set: smiles= | + | * CHEBI: |
| − | {{#set: inchi key=InChIKey= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58405 58405] |
| − | {{#set: common name= | + | * BIGG : 42055 |
| − | {{#set: molecular weight= | + | * LIGAND-CPD: |
| − | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04574 C04574] |
| − | {{#set: produced by= | + | {{#set: smiles=CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP([O-])(=O)OP(=O)([O-])[O-])C)C)C}} |
| + | {{#set: inchi key=InChIKey=NTXGVHCCXVHYCL-NTDVEAECSA-K}} | ||
| + | {{#set: common name=di-trans,octa-cis-undecaprenyl diphosphate}} | ||
| + | {{#set: molecular weight=924.251 }} | ||
| + | {{#set: common name=di-trans-poly-cis-undecaprenyl diphosphate|undecaprenyl-PP (ambiguous)|bactoprenyl pyrophosphate|undecaprenyl pyrophosphate (ambiguous)|UPP (ambiguous)|di-trans,octa-cis-undecaprenyl diphosphate}} | ||
| + | {{#set: produced by=RXN-8999}} | ||
Revision as of 21:37, 17 March 2018
Contents
Metabolite UNDECAPRENYL-DIPHOSPHATE
- smiles:
- CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP([O-])(=O)OP(=O)([O-])[O-])C)C)C
- inchi key:
- InChIKey=NTXGVHCCXVHYCL-NTDVEAECSA-K
- common name:
- di-trans,octa-cis-undecaprenyl diphosphate
- molecular weight:
- 924.251
- Synonym(s):
- di-trans-poly-cis-undecaprenyl diphosphate
- undecaprenyl-PP (ambiguous)
- bactoprenyl pyrophosphate
- undecaprenyl pyrophosphate (ambiguous)
- UPP (ambiguous)
- di-trans,octa-cis-undecaprenyl diphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP([O-])(=O)OP(=O)([O-])[O-])C)C)C" cannot be used as a page name in this wiki.
