Difference between revisions of "CPD-11020"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UNDECAPRENYL-DIPHOSPHATE UNDECAPRENYL-DIPHOSPHATE] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(C)=CCCC...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12015 CPD-12015] == * smiles: ** CC(=O)NCCC1(C2(=C(NC=1)C=C(OS([O-])(=O)=O)C(OC)=C2)) * inc...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12015 CPD-12015] == |
* smiles: | * smiles: | ||
− | ** CC(= | + | ** CC(=O)NCCC1(C2(=C(NC=1)C=C(OS([O-])(=O)=O)C(OC)=C2)) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=QQEILXDLZRLTME-UHFFFAOYSA-M |
* common name: | * common name: | ||
− | ** | + | ** 6-sulfatoxymelatonin |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 327.331 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 6-sulphatoxymelatonin |
− | ** | + | ** 6-hydroxymelatoninsulfate |
− | ** | + | ** 6-hydroxymelatonin sulfate ester |
− | ** | + | ** acetamide, N-(2-(5-methoxy-6-(sulfooxy)-1H-indol-3-yl)ethyl)- |
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-11058]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=65096 65096] |
− | * | + | * CHEMSPIDER: |
− | ** [http://www. | + | ** [http://www.chemspider.com/Chemical-Structure.58606.html 58606] |
− | * | + | * HMDB : HMDB41815 |
− | + | {{#set: smiles=CC(=O)NCCC1(C2(=C(NC=1)C=C(OS([O-])(=O)=O)C(OC)=C2))}} | |
− | + | {{#set: inchi key=InChIKey=QQEILXDLZRLTME-UHFFFAOYSA-M}} | |
− | {{#set: smiles=CC(= | + | {{#set: common name=6-sulfatoxymelatonin}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: molecular weight=327.331 }} |
− | {{#set: common name= | + | {{#set: common name=6-sulphatoxymelatonin|6-hydroxymelatoninsulfate|6-hydroxymelatonin sulfate ester|acetamide, N-(2-(5-methoxy-6-(sulfooxy)-1H-indol-3-yl)ethyl)-}} |
− | {{#set: molecular weight= | + | {{#set: produced by=RXN-11058}} |
− | {{#set: common name= | + | |
− | {{#set: produced by=RXN- | + |
Revision as of 21:37, 17 March 2018
Contents
Metabolite CPD-12015
- smiles:
- CC(=O)NCCC1(C2(=C(NC=1)C=C(OS([O-])(=O)=O)C(OC)=C2))
- inchi key:
- InChIKey=QQEILXDLZRLTME-UHFFFAOYSA-M
- common name:
- 6-sulfatoxymelatonin
- molecular weight:
- 327.331
- Synonym(s):
- 6-sulphatoxymelatonin
- 6-hydroxymelatoninsulfate
- 6-hydroxymelatonin sulfate ester
- acetamide, N-(2-(5-methoxy-6-(sulfooxy)-1H-indol-3-yl)ethyl)-
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=O)NCCC1(C2(=C(NC=1)C=C(OS([O-])(=O)=O)C(OC)=C2))" cannot be used as a page name in this wiki.