Difference between revisions of "Ec-19 003590"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11020 CPD-11020] == * smiles: ** C(=O)([O-])C(=O)CC(O)CCl * inchi key: ** InChIKey=FHWPHVIG...")
 
(Created page with "Category:Gene == Gene Ec-19_001050 == * left end position: ** 1214586 * transcription direction: ** NEGATIVE * right end position: ** 1219794 * centisome position: ** 20.3...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11020 CPD-11020] ==
+
== Gene Ec-19_001050 ==
* smiles:
+
* left end position:
** C(=O)([O-])C(=O)CC(O)CCl
+
** 1214586
* inchi key:
+
* transcription direction:
** InChIKey=FHWPHVIGZZAXIQ-VKHMYHEASA-M
+
** NEGATIVE
* common name:
+
* right end position:
** 5-chloro-4-hydroxy-2-oxopentanoate
+
** 1219794
* molecular weight:
+
* centisome position:
** 165.553    
+
** 20.34248    
 
* Synonym(s):
 
* Synonym(s):
** 5-chloro-4-hydroxy-2-oxovalerate
+
** Esi_0343_0034
 +
** Esi0343_0034
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
* [[RXN-11717]]
+
** esiliculosus_genome
== Reaction(s) of unknown directionality ==
+
***automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=1214586}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49859580 49859580]
+
{{#set: transcription direction=NEGATIVE}}
{{#set: smiles=C(=O)([O-])C(=O)CC(O)CCl}}
+
{{#set: right end position=1219794}}
{{#set: inchi key=InChIKey=FHWPHVIGZZAXIQ-VKHMYHEASA-M}}
+
{{#set: centisome position=20.34248   }}
{{#set: common name=5-chloro-4-hydroxy-2-oxopentanoate}}
+
{{#set: common name=Esi_0343_0034|Esi0343_0034}}
{{#set: molecular weight=165.553   }}
+
{{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}}
{{#set: common name=5-chloro-4-hydroxy-2-oxovalerate}}
+
{{#set: produced by=RXN-11717}}
+

Revision as of 21:37, 17 March 2018

Gene Ec-19_001050

  • left end position:
    • 1214586
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 1219794
  • centisome position:
    • 20.34248
  • Synonym(s):
    • Esi_0343_0034
    • Esi0343_0034

Reactions associated

Pathways associated

External links