Difference between revisions of "RXN-17688"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1130 CPD-1130] == * smiles: ** CCC(C(=O)[O-])C(C([O-])=O)O * inchi key: ** InChIKey=JUCRENB...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9157 RXN-9157] == * direction: ** LEFT-TO-RIGHT * common name: ** Gamma-glutamyltranspeptidase...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9157 RXN-9157] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** Gamma-glutamyltranspeptidase |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/2.3.2.2 EC-2.3.2.2] |
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | == | + | ** 1 [[GLUTATHIONE]][c] '''+''' 1 [[CPD-9699]][c] '''=>''' 1 [[CPD-9700]][c] '''+''' 1 [[CYS-GLY]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 glutathione[c] '''+''' 1 hypoglycin A[c] '''=>''' 1 hypoglycin B[c] '''+''' 1 L-cysteinyl-glycine[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * [[Ec-21_006220]] | ||
| + | ** ESILICULOSUS_GENOME | ||
| + | ***EC-NUMBER | ||
| + | == Pathways == | ||
| + | * [[PWY-5826]], hypoglycin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5826 PWY-5826] | ||
| + | ** '''4''' reactions found over '''14''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=Gamma-glutamyltranspeptidase}} | |
| − | + | {{#set: ec number=EC-2.3.2.2}} | |
| − | + | {{#set: gene associated=Ec-21_006220}} | |
| − | + | {{#set: in pathway=PWY-5826}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 21:37, 17 March 2018
Contents
Reaction RXN-9157
- direction:
- LEFT-TO-RIGHT
- common name:
- Gamma-glutamyltranspeptidase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 GLUTATHIONE[c] + 1 CPD-9699[c] => 1 CPD-9700[c] + 1 CYS-GLY[c]
- With common name(s):
- 1 glutathione[c] + 1 hypoglycin A[c] => 1 hypoglycin B[c] + 1 L-cysteinyl-glycine[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Ec-21_006220
- ESILICULOSUS_GENOME
- EC-NUMBER
- ESILICULOSUS_GENOME
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
