Difference between revisions of "ACP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12015 CPD-12015] == * smiles: ** CC(=O)NCCC1(C2(=C(NC=1)C=C(OS([O-])(=O)=O)C(OC)=C2)) * inc...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN490-3641 RXN490-3641] == * direction: ** LEFT-TO-RIGHT * common name: ** proline,2-oxoglutarate-...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12015 CPD-12015] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN490-3641 RXN490-3641] ==
* smiles:
+
* direction:
** CC(=O)NCCC1(C2(=C(NC=1)C=C(OS([O-])(=O)=O)C(OC)=C2))
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=QQEILXDLZRLTME-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
** 6-sulfatoxymelatonin
+
** proline,2-oxoglutarate-4-dioxygenase (cis-4-hydroxy-L-proline)
* molecular weight:
+
* ec number:
** 327.331   
+
** [http://enzyme.expasy.org/EC/1.14.11 EC-1.14.11]
 
* Synonym(s):
 
* Synonym(s):
** 6-sulphatoxymelatonin
+
** prolyl hydroxylase
** 6-hydroxymelatoninsulfate
+
** prolyl 4-hydroxylase
** 6-hydroxymelatonin sulfate ester
+
** proline,2-oxoglutarate 4-dioxygenase
** acetamide, N-(2-(5-methoxy-6-(sulfooxy)-1H-indol-3-yl)ethyl)-
+
** proline hydroxylase
 +
** protocollagen hydroxylase
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-11058]]
+
** 1 [[PRO]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[2-KETOGLUTARATE]][c] '''=>''' 1 [[4-HYDROXY-L-PROLINE]][c] '''+''' 1 [[SUC]][c] '''+''' 1 [[CARBON-DIOXIDE]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 L-proline[c] '''+''' 1 oxygen[c] '''+''' 1 2-oxoglutarate[c] '''=>''' 1 trans-4-hydroxy-L-proline[c] '''+''' 1 succinate[c] '''+''' 1 CO2[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Ec-07_001070]]
 +
** [[pantograph]]-[[aragem]]
 +
* [[Ec-08_002170]]
 +
** [[pantograph]]-[[aragem]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* LIGAND-RXN:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=65096 65096]
+
** [http://www.genome.jp/dbget-bin/www_bget?R01252 R01252]
* CHEMSPIDER:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://www.chemspider.com/Chemical-Structure.58606.html 58606]
+
{{#set: common name=proline,2-oxoglutarate-4-dioxygenase (cis-4-hydroxy-L-proline)}}
* HMDB : HMDB41815
+
{{#set: ec number=EC-1.14.11}}
{{#set: smiles=CC(=O)NCCC1(C2(=C(NC=1)C=C(OS([O-])(=O)=O)C(OC)=C2))}}
+
{{#set: common name=prolyl hydroxylase|prolyl 4-hydroxylase|proline,2-oxoglutarate 4-dioxygenase|proline hydroxylase|protocollagen hydroxylase}}
{{#set: inchi key=InChIKey=QQEILXDLZRLTME-UHFFFAOYSA-M}}
+
{{#set: gene associated=Ec-07_001070|Ec-08_002170}}
{{#set: common name=6-sulfatoxymelatonin}}
+
{{#set: in pathway=}}
{{#set: molecular weight=327.331    }}
+
{{#set: reconstruction category=orthology}}
{{#set: common name=6-sulphatoxymelatonin|6-hydroxymelatoninsulfate|6-hydroxymelatonin sulfate ester|acetamide, N-(2-(5-methoxy-6-(sulfooxy)-1H-indol-3-yl)ethyl)-}}
+
{{#set: reconstruction source=orthology-aragem}}
{{#set: produced by=RXN-11058}}
+
{{#set: reconstruction tool=pantograph}}

Revision as of 21:38, 17 March 2018

Reaction RXN490-3641

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • proline,2-oxoglutarate-4-dioxygenase (cis-4-hydroxy-L-proline)
  • ec number:
  • Synonym(s):
    • prolyl hydroxylase
    • prolyl 4-hydroxylase
    • proline,2-oxoglutarate 4-dioxygenase
    • proline hydroxylase
    • protocollagen hydroxylase

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links