Difference between revisions of "FADH2"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COUMARATE COUMARATE] == * smiles: ** C(=O)([O-])C=CC1(=CC=C(O)C=C1) * inchi key: ** InChIKey=NG...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Long-Chain-Aldehydes Long-Chain-Aldehydes] == * common name: ** a long-chain aldehyde * Synonym...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COUMARATE COUMARATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Long-Chain-Aldehydes Long-Chain-Aldehydes] ==
* smiles:
+
** C(=O)([O-])C=CC1(=CC=C(O)C=C1)
+
* inchi key:
+
** InChIKey=NGSWKAQJJWESNS-ZZXKWVIFSA-M
+
 
* common name:
 
* common name:
** 4-coumarate
+
** a long-chain aldehyde
* molecular weight:
+
** 163.152   
+
 
* Synonym(s):
 
* Synonym(s):
** 4-hydroxycinnamate
+
** a long-chain fatty aldehyde
** 4-hydroxycinnamic acid
+
** p-coumarate
+
** trans-4-hydroxycinnamate
+
** p-coumaric acid
+
** trans-p-hydroxycinnamate
+
** trans-4-coumarate
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[4-COUMARATE--COA-LIGASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[LONG-CHAIN-FATTY-ACYL-COA-REDUCTASE-RXN]]
 
== External links  ==
 
== External links  ==
* CAS : 7400-08-0
+
{{#set: common name=a long-chain aldehyde}}
* PUBCHEM:
+
{{#set: common name=a long-chain fatty aldehyde}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54708745 54708745]
+
{{#set: reversible reaction associated=LONG-CHAIN-FATTY-ACYL-COA-REDUCTASE-RXN}}
* HMDB : HMDB02035
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00811 C00811]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.4450678.html 4450678]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=12876 12876]
+
* METABOLIGHTS : MTBLC12876
+
{{#set: smiles=C(=O)([O-])C=CC1(=CC=C(O)C=C1)}}
+
{{#set: inchi key=InChIKey=NGSWKAQJJWESNS-ZZXKWVIFSA-M}}
+
{{#set: common name=4-coumarate}}
+
{{#set: molecular weight=163.152    }}
+
{{#set: common name=4-hydroxycinnamate|4-hydroxycinnamic acid|p-coumarate|trans-4-hydroxycinnamate|p-coumaric acid|trans-p-hydroxycinnamate|trans-4-coumarate}}
+
{{#set: consumed by=4-COUMARATE--COA-LIGASE-RXN}}
+

Revision as of 21:38, 17 March 2018

Metabolite Long-Chain-Aldehydes

  • common name:
    • a long-chain aldehyde
  • Synonym(s):
    • a long-chain fatty aldehyde

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links