Difference between revisions of "Ec-05 004740"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GALACTONATE D-GALACTONATE] == * smiles: ** C(O)C(O)C(O)C(O)C(O)C(=O)[O-] * inchi key: ** InCh...") |
(Created page with "Category:Gene == Gene Ec-10_005500 == * left end position: ** 5582650 * transcription direction: ** POSITIVE * right end position: ** 5587720 * centisome position: ** 85.8...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-10_005500 == |
− | * | + | * left end position: |
− | ** | + | ** 5582650 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 5587720 |
− | * | + | * centisome position: |
− | ** | + | ** 85.87391 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0006_0086 |
+ | ** Esi0006_0086 | ||
− | == | + | == Reactions associated == |
− | + | * [[GUANYLCYC-RXN]] | |
− | * [[ | + | ** esiliculosus_genome |
− | == | + | ***automated-name-match |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=5582650}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=5587720}} | |
− | + | {{#set: centisome position=85.87391 }} | |
− | + | {{#set: common name=Esi_0006_0086|Esi0006_0086}} | |
− | + | {{#set: reaction associated=GUANYLCYC-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 21:39, 17 March 2018
Gene Ec-10_005500
- left end position:
- 5582650
- transcription direction:
- POSITIVE
- right end position:
- 5587720
- centisome position:
- 85.87391
- Synonym(s):
- Esi_0006_0086
- Esi0006_0086
Reactions associated
- GUANYLCYC-RXN
- esiliculosus_genome
- automated-name-match
- esiliculosus_genome