Difference between revisions of "CANAVANINOSUCCINATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET 2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET] == * smiles:...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14274 RXN-14274] == * direction: ** REVERSIBLE * common name: ** decanoyl-CoA C-acyltransferase...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET 2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14274 RXN-14274] ==
−
* smiles:
+
* direction:
−
** CC(OP(=O)([O-])[O-])(CO)C(O)COP(OP([O-])(=O)OCC2(C(O)C(O)C(N1(C=CC(N)=NC(=O)1))O2))([O-])=O
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=HTJXTKBIUVFUAR-XHIBXCGHSA-J
+
 
* common name:
 
* common name:
−
** 2-phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol
+
** decanoyl-CoA C-acyltransferase
−
* molecular weight:
+
* ec number:
−
** 597.259   
+
** [http://enzyme.expasy.org/EC/2.3.1.16 EC-2.3.1.16]
 
* Synonym(s):
 
* Synonym(s):
−
** CDP-ME-2P
 
−
** CDP-methyl-D-erylthritol 2-phosphate
 
−
** 4-diphosphocytidyl-2C-methyl-D-erythritol 2-phosphate
 
−
** 4-diphosphocytidyl-2-C-methylerythritol 2-phosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN0-302]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[ACETYL-COA]][c] '''+''' 1 [[CPD-10267]][c] '''<=>''' 1 [[CPD0-2105]][c] '''+''' 1 [[CO-A]][c]
−
* [[2.7.1.148-RXN]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 acetyl-CoA[c] '''+''' 1 decanoyl-CoA[c] '''<=>''' 1 3-oxododecanoyl-CoA[c] '''+''' 1 coenzyme A[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Ec-26_003940]]
 +
** [[pantograph]]-[[aragem]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878430 46878430]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=31185 31185]
−
* CHEBI:
+
* LIGAND-RXN:
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57919 57919]
+
** [http://www.genome.jp/dbget-bin/www_bget?R04742 R04742]
−
* BIGG : 216335
+
{{#set: direction=REVERSIBLE}}
−
* LIGAND-CPD:
+
{{#set: common name=decanoyl-CoA C-acyltransferase}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C11436 C11436]
+
{{#set: ec number=EC-2.3.1.16}}
−
{{#set: smiles=CC(OP(=O)([O-])[O-])(CO)C(O)COP(OP([O-])(=O)OCC2(C(O)C(O)C(N1(C=CC(N)=NC(=O)1))O2))([O-])=O}}
+
{{#set: gene associated=Ec-26_003940}}
−
{{#set: inchi key=InChIKey=HTJXTKBIUVFUAR-XHIBXCGHSA-J}}
+
{{#set: in pathway=}}
−
{{#set: common name=2-phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: molecular weight=597.259    }}
+
{{#set: reconstruction source=orthology-aragem}}
−
{{#set: common name=CDP-ME-2P|CDP-methyl-D-erylthritol 2-phosphate|4-diphosphocytidyl-2C-methyl-D-erythritol 2-phosphate|4-diphosphocytidyl-2-C-methylerythritol 2-phosphate}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: consumed by=RXN0-302}}
+
−
{{#set: produced by=2.7.1.148-RXN}}
+

Revision as of 22:39, 17 March 2018

Reaction RXN-14274

  • direction:
    • REVERSIBLE
  • common name:
    • decanoyl-CoA C-acyltransferase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 acetyl-CoA[c] + 1 decanoyl-CoA[c] <=> 1 3-oxododecanoyl-CoA[c] + 1 coenzyme A[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CANAVANINOSUCCINATE&oldid=13919"