Difference between revisions of "CPD-11671"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-TP GDP-TP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(OP(=O)([O...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9787 RXN-9787] == * direction: ** REVERSIBLE * common name: ** cysteine:[ThiI sulfur-carrier pr...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-TP GDP-TP] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9787 RXN-9787] ==
−
* smiles:
+
* direction:
−
** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(OP(=O)([O-])OP(=O)(O)[O-])1)N3(C=NC2(C(=O)NC(N)=NC=23)))
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=KCPMACXZAITQAX-UUOKFMHZSA-H
+
 
* common name:
 
* common name:
−
** pppGpp
+
** cysteine:[ThiI sulfur-carrier protein]-L-cysteine sulfurtransferase desulfurase
−
* molecular weight:
+
** Aminotransferase class V domain
−
** 677.095   
+
** Cysteine desulfurase
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.8.1.7 EC-2.8.1.7]
 
* Synonym(s):
 
* Synonym(s):
−
** guanosine pentaphosphate
 
−
** guanosine 3'-diphosphate 5'-triphosphate
 
−
** guanosine 5'-triphosphate,3'-diphosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[GTPPYPHOSKIN-RXN]]
+
** 1 [[CYS]][c] '''+''' 1 [[Sulfur-Carrier-Proteins-ThiI]][c] '''<=>''' 1 [[L-ALPHA-ALANINE]][c] '''+''' 1 [[Sulfurylated-ThiI]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 L-cysteine[c] '''+''' 1 a ThiI sulfur-carrier protein[c] '''<=>''' 1 L-alanine[c] '''+''' 1 an S-sulfanyl-[ThiI sulfur-carrier protein][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Ec-21_003740]]
 +
** ESILICULOSUS_GENOME
 +
***EC-NUMBER
 +
* [[Ec-22_000950]]
 +
** ESILICULOSUS_GENOME
 +
***EC-NUMBER
 +
* [[Ec-21_005640]]
 +
** ESILICULOSUS_GENOME
 +
***EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: direction=REVERSIBLE}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04494 C04494]
+
{{#set: common name=cysteine:[ThiI sulfur-carrier protein]-L-cysteine sulfurtransferase desulfurase}}
−
* CHEBI:
+
{{#set: common name=Aminotransferase class V domain}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16690 16690]
+
{{#set: common name=Cysteine desulfurase}}
−
* BIGG : 43927
+
{{#set: ec number=EC-2.8.1.7}}
−
* PUBCHEM:
+
{{#set: gene associated=Ec-21_003740|Ec-22_000950|Ec-21_005640}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173549 46173549]
+
{{#set: in pathway=}}
−
* HMDB : HMDB60480
+
{{#set: reconstruction category=annotation}}
−
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(OP(=O)([O-])OP(=O)(O)[O-])1)N3(C=NC2(C(=O)NC(N)=NC=23)))}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: inchi key=InChIKey=KCPMACXZAITQAX-UUOKFMHZSA-H}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: common name=pppGpp}}
+
−
{{#set: molecular weight=677.095    }}
+
−
{{#set: common name=guanosine pentaphosphate|guanosine 3'-diphosphate 5'-triphosphate|guanosine 5'-triphosphate,3'-diphosphate}}
+
−
{{#set: produced by=GTPPYPHOSKIN-RXN}}
+

Revision as of 21:39, 17 March 2018

Reaction RXN-9787

  • direction:
    • REVERSIBLE
  • common name:
    • cysteine:[ThiI sulfur-carrier protein]-L-cysteine sulfurtransferase desulfurase
    • Aminotransferase class V domain
    • Cysteine desulfurase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

"cysteine:[ThiI sulfur-carrier protein]-L-cysteine sulfurtransferase desulfurase" cannot be used as a page name in this wiki.





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-11671&oldid=13928"