Difference between revisions of "Ec-26 006330"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14382 RXN-14382] == * direction: ** LEFT-TO-RIGHT * common name: ** Aminotransferase class V do...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19147 CPD-19147] == * smiles: ** CCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14382 RXN-14382] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19147 CPD-19147] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 +
* inchi key:
 +
** InChIKey=JPIHVKICKVPFFY-TWAFKMGKSA-J
 
* common name:
 
* common name:
−
** Aminotransferase class V domain
+
** (7Z)-tetradecenoyl-CoA
−
** Cysteine desulfurase
+
* molecular weight:
 +
** 971.845   
 
* Synonym(s):
 
* Synonym(s):
 +
** 14:1-Δ7-CoA
 +
** cis-7-tetradecenoyl-CoA
 +
** 14:1(n-7)-CoA
 +
** (7Z)-tetradec-7-enoyl-CoA
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-17792]]
−
** 1 [[L-Cysteine-Desulfurase-persulfide]][c] '''+''' 1 [[Sulfur-Carrier-Proteins-ThiI]][c] '''=>''' 1 [[Cysteine-Desulfurase-L-cysteine]][c] '''+''' 1 [[Sulfurylated-ThiI]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 an [L-cysteine desulfurase] L-cysteine persulfide[c] '''+''' 1 a ThiI sulfur-carrier protein[c] '''=>''' 1 an [L-cysteine desulfurase]-L-cysteine[c] '''+''' 1 an S-sulfanyl-[ThiI sulfur-carrier protein][c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-21_005640]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
* [[Ec-22_000950]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
* [[Ec-21_003740]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-6892]], thiazole biosynthesis I (facultative anaerobic bacteria): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6892 PWY-6892]
+
−
** '''3''' reactions found over '''7''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=CCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
−
{{#set: common name=Aminotransferase class V domain}}
+
{{#set: inchi key=InChIKey=JPIHVKICKVPFFY-TWAFKMGKSA-J}}
−
{{#set: common name=Cysteine desulfurase}}
+
{{#set: common name=(7Z)-tetradecenoyl-CoA}}
−
{{#set: gene associated=Ec-21_005640|Ec-22_000950|Ec-21_003740}}
+
{{#set: molecular weight=971.845    }}
−
{{#set: in pathway=PWY-6892}}
+
{{#set: common name=14:1-Δ7-CoA|cis-7-tetradecenoyl-CoA|14:1(n-7)-CoA|(7Z)-tetradec-7-enoyl-CoA}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: consumed by=RXN-17792}}
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=esiliculosus_genome}}
+

Revision as of 22:40, 17 March 2018

Metabolite CPD-19147

  • smiles:
    • CCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=JPIHVKICKVPFFY-TWAFKMGKSA-J
  • common name:
    • (7Z)-tetradecenoyl-CoA
  • molecular weight:
    • 971.845
  • Synonym(s):
    • 14:1-Δ7-CoA
    • cis-7-tetradecenoyl-CoA
    • 14:1(n-7)-CoA
    • (7Z)-tetradec-7-enoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-26_006330&oldid=13941"