Difference between revisions of "1.8.1.4-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-316 CPD-316] == * smiles: ** CC1(=C(C=C2(C(=C1)NC3(C(N2CC(O)C(O)C(O)CO)=NC(NC3=O)=O)))C) *...") |
(Created page with "Category:Gene == Gene Ec-16_004110 == * left end position: ** 4230445 * transcription direction: ** POSITIVE * right end position: ** 4234294 * centisome position: ** 79.2...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-16_004110 == |
− | * | + | * left end position: |
− | ** | + | ** 4230445 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 4234294 |
− | * | + | * centisome position: |
− | ** | + | ** 79.25664 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0430_0007 |
− | ** | + | ** Esi0430_0007 |
− | + | ||
− | == | + | == Reactions associated == |
− | + | * [[CHOLINE-KINASE-RXN]] | |
− | * [[ | + | ** esiliculosus_genome |
− | * [[ | + | ***automated-name-match |
− | == | + | * [[ETHANOLAMINE-KINASE-RXN]] |
+ | ** esiliculosus_genome | ||
+ | ***automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7782]] | ||
+ | * [[PWY4FS-6]] | ||
+ | * [[PWY-3385]] | ||
+ | * [[PWY3O-450]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=4230445}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=4234294}} | |
− | + | {{#set: centisome position=79.25664 }} | |
− | + | {{#set: common name=Esi_0430_0007|Esi0430_0007}} | |
− | + | {{#set: reaction associated=CHOLINE-KINASE-RXN|ETHANOLAMINE-KINASE-RXN}} | |
− | + | {{#set: pathway associated=PWY-7782|PWY4FS-6|PWY-3385|PWY3O-450}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 21:40, 17 March 2018
Gene Ec-16_004110
- left end position:
- 4230445
- transcription direction:
- POSITIVE
- right end position:
- 4234294
- centisome position:
- 79.25664
- Synonym(s):
- Esi_0430_0007
- Esi0430_0007
Reactions associated
- CHOLINE-KINASE-RXN
- esiliculosus_genome
- automated-name-match
- esiliculosus_genome
- ETHANOLAMINE-KINASE-RXN
- esiliculosus_genome
- automated-name-match
- esiliculosus_genome