Difference between revisions of "Cis-21-CP-39-keto-40-Me-C60-ACPs"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-00_002010 == * left end position: ** 2232528 * transcription direction: ** POSITIVE * right end position: ** 2238780 * centisome position: ** 11.7...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-PRENYLPHLORISOBUTYROPHENONE 4-PRENYLPHLORISOBUTYROPHENONE] == * smiles: ** CC(=CCC1(=C(C=C(C(...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-PRENYLPHLORISOBUTYROPHENONE 4-PRENYLPHLORISOBUTYROPHENONE] == |
− | * | + | * smiles: |
− | ** | + | ** CC(=CCC1(=C(C=C(C(=C1O)C(C(C)C)=O)O)[O-]))C |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=IOBXAMCSYCVNET-UHFFFAOYSA-M |
− | * | + | * common name: |
− | ** | + | ** 4-prenylphlorisobutyrophenone |
− | * | + | * molecular weight: |
− | ** | + | ** 263.313 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** compound co-X |
− | ** | + | ** PPIBP |
+ | ** dimethylallyl-phlorisobutyrophenone | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-7813]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | == | + | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203134 25203134] |
− | {{#set: | + | {{#set: smiles=CC(=CCC1(=C(C=C(C(=C1O)C(C(C)C)=O)O)[O-]))C}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=IOBXAMCSYCVNET-UHFFFAOYSA-M}} |
− | {{#set: common name= | + | {{#set: common name=4-prenylphlorisobutyrophenone}} |
− | + | {{#set: molecular weight=263.313 }} | |
− | {{#set: | + | {{#set: common name=compound co-X|PPIBP|dimethylallyl-phlorisobutyrophenone}} |
+ | {{#set: consumed by=RXN-7813}} |
Revision as of 22:40, 17 March 2018
Contents
Metabolite 4-PRENYLPHLORISOBUTYROPHENONE
- smiles:
- CC(=CCC1(=C(C=C(C(=C1O)C(C(C)C)=O)O)[O-]))C
- inchi key:
- InChIKey=IOBXAMCSYCVNET-UHFFFAOYSA-M
- common name:
- 4-prenylphlorisobutyrophenone
- molecular weight:
- 263.313
- Synonym(s):
- compound co-X
- PPIBP
- dimethylallyl-phlorisobutyrophenone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(=CCC1(=C(C=C(C(=C1O)C(C(C)C)=O)O)[O-]))C" cannot be used as a page name in this wiki.