Difference between revisions of "RIBOSE-1P"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4127 CPD-4127] == * smiles: ** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2...")
 
(Created page with "Category:Gene == Gene Ec-04_001390 == * left end position: ** 1590712 * transcription direction: ** POSITIVE * right end position: ** 1593520 * centisome position: ** 24.4...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4127 CPD-4127] ==
+
== Gene Ec-04_001390 ==
−
* smiles:
+
* left end position:
−
** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** 1590712
−
* inchi key:
+
* transcription direction:
−
** InChIKey=OSELKOCHBMDKEJ-WGMIZEQOSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** isofucosterol
+
** 1593520
−
* molecular weight:
+
* centisome position:
−
** 412.698    
+
** 24.427956    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0015_0186
 +
** Esi0015_0186
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[PROTEIN-KINASE-RXN]]
−
* [[RXN-4210]]
+
** esiliculosus_genome
−
== Reaction(s) of unknown directionality ==
+
***go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1590712}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244964 25244964]
+
{{#set: transcription direction=POSITIVE}}
−
* LIGAND-CPD:
+
{{#set: right end position=1593520}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C08821 C08821]
+
{{#set: centisome position=24.427956    }}
−
* HMDB : HMDB02374
+
{{#set: common name=Esi_0015_0186|Esi0015_0186}}
−
{{#set: smiles=CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
−
{{#set: inchi key=InChIKey=OSELKOCHBMDKEJ-WGMIZEQOSA-N}}
+
−
{{#set: common name=isofucosterol}}
+
−
{{#set: molecular weight=412.698    }}
+
−
{{#set: produced by=RXN-4210}}
+

Revision as of 21:40, 17 March 2018

Gene Ec-04_001390

  • left end position:
    • 1590712
  • transcription direction:
    • POSITIVE
  • right end position:
    • 1593520
  • centisome position:
    • 24.427956
  • Synonym(s):
    • Esi_0015_0186
    • Esi0015_0186

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RIBOSE-1P&oldid=14002"