Difference between revisions of "RXN3DJ-25"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBOSE-1P RIBOSE-1P] == * smiles: ** C(O)C1(C(O)C(O)C(OP(=O)([O-])[O-])O1) * inchi key: ** InCh...") |
(Created page with "Category:Gene == Gene Ec-06_002180 == * left end position: ** 1540823 * transcription direction: ** NEGATIVE * right end position: ** 1543014 * centisome position: ** 17.5...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-06_002180 == |
− | * | + | * left end position: |
− | ** | + | ** 1540823 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 1543014 |
− | * | + | * centisome position: |
− | ** | + | ** 17.593807 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0350_0017 |
− | ** | + | ** Esi0350_0017 |
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | + | * [[PEPTIDYLPROLYL-ISOMERASE-RXN]] | |
− | + | ** esiliculosus_genome | |
− | * [[ | + | ***automated-name-match |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=1540823}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=1543014}} | |
− | + | {{#set: centisome position=17.593807 }} | |
− | + | {{#set: common name=Esi_0350_0017|Esi0350_0017}} | |
− | + | {{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 21:41, 17 March 2018
Gene Ec-06_002180
- left end position:
- 1540823
- transcription direction:
- NEGATIVE
- right end position:
- 1543014
- centisome position:
- 17.593807
- Synonym(s):
- Esi_0350_0017
- Esi0350_0017
Reactions associated
- PEPTIDYLPROLYL-ISOMERASE-RXN
- esiliculosus_genome
- automated-name-match
- esiliculosus_genome