Difference between revisions of "Ec-02 005420"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9245 CPD-9245] == * smiles: ** CCCCCCC=CCCCCCCCC(=O)[O-] * inchi key: ** InChIKey=SECPZKHBE...") |
(Created page with "Category:Gene == Gene Ec-10_006360 == * left end position: ** 6385066 * transcription direction: ** NEGATIVE * right end position: ** 6393748 * centisome position: ** 98.2...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-10_006360 == |
− | * | + | * left end position: |
− | ** | + | ** 6385066 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 6393748 |
− | * | + | * centisome position: |
− | ** | + | ** 98.2169 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0006_0214 |
− | ** | + | ** Esi0006_0214 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[1.2.4.4-RXN]] |
− | + | ** esiliculosus_genome | |
− | * | + | ***ec-number |
− | * [[ | + | * [[KETOISOCAPROATE-RXN]] |
− | * [[ | + | ** esiliculosus_genome |
− | == | + | ***ec-number |
+ | * [[METHYLVALERATE-RXN]] | ||
+ | ** esiliculosus_genome | ||
+ | ***ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-5046]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=6385066}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=6393748}} | |
− | + | {{#set: centisome position=98.2169 }} | |
− | + | {{#set: common name=Esi_0006_0214|Esi0006_0214}} | |
− | + | {{#set: reaction associated=1.2.4.4-RXN|KETOISOCAPROATE-RXN|METHYLVALERATE-RXN}} | |
− | + | {{#set: pathway associated=PWY-5046}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 21:42, 17 March 2018
Gene Ec-10_006360
- left end position:
- 6385066
- transcription direction:
- NEGATIVE
- right end position:
- 6393748
- centisome position:
- 98.2169
- Synonym(s):
- Esi_0006_0214
- Esi0006_0214
Reactions associated
- 1.2.4.4-RXN
- esiliculosus_genome
- ec-number
- esiliculosus_genome
- KETOISOCAPROATE-RXN
- esiliculosus_genome
- ec-number
- esiliculosus_genome
- METHYLVALERATE-RXN
- esiliculosus_genome
- ec-number
- esiliculosus_genome