Difference between revisions of "Ec-25 002630"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10794 CPD-10794] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP([O-])(...")
 
(Created page with "Category:Gene == Gene Ec-19_005440 == * left end position: ** 5916383 * transcription direction: ** NEGATIVE * right end position: ** 5928604 * centisome position: ** 99.0...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10794 CPD-10794] ==
+
== Gene Ec-19_005440 ==
−
* smiles:
+
* left end position:
−
** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP([O-])(=O)OCC4(C(O)C(O)C(O4)OP(=O)([O-])[O-]))(=O)[O-]
+
** 5916383
−
* inchi key:
+
* transcription direction:
−
** InChIKey=CUNFRFHBHMFVPH-TYASJMOZSA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** ADP ribose 1''-phosphate
+
** 5928604
−
* molecular weight:
+
* centisome position:
−
** 635.268    
+
** 99.09048    
 
* Synonym(s):
 
* Synonym(s):
−
** adenosine diphosphate ribose 1'' phosphate
+
** Esi_0154_0009
 +
** Esi0154_0009
 +
** ASPRS
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-10034]]
+
* [[ASPARTATE--TRNA-LIGASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** esiliculosus_genome
−
* [[RXN-12055]]
+
***ec-number
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[TRNA-CHARGING-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=5916383}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44123525 44123525]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP([O-])(=O)OCC4(C(O)C(O)C(O4)OP(=O)([O-])[O-]))(=O)[O-]}}
+
{{#set: right end position=5928604}}
−
{{#set: inchi key=InChIKey=CUNFRFHBHMFVPH-TYASJMOZSA-J}}
+
{{#set: centisome position=99.09048   }}
−
{{#set: common name=ADP ribose 1''-phosphate}}
+
{{#set: common name=Esi_0154_0009|Esi0154_0009|ASPRS}}
−
{{#set: molecular weight=635.268   }}
+
{{#set: reaction associated=ASPARTATE--TRNA-LIGASE-RXN}}
−
{{#set: common name=adenosine diphosphate ribose 1'' phosphate}}
+
{{#set: pathway associated=TRNA-CHARGING-PWY}}
−
{{#set: consumed by=RXN-10034}}
+
−
{{#set: produced by=RXN-12055}}
+

Revision as of 21:42, 17 March 2018

Gene Ec-19_005440

  • left end position:
    • 5916383
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 5928604
  • centisome position:
    • 99.09048
  • Synonym(s):
    • Esi_0154_0009
    • Esi0154_0009
    • ASPRS

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-25_002630&oldid=14095"