Difference between revisions of "Charged-CYS-tRNAs"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-16_004800 == * Synonym(s): ** Esi_0164_0034 ** Esi0164_0034 == Reactions associated == * RXN-8443 ** pantograph-aragem == Pathways as...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=T2-C4-DECADIENYL-COA T2-C4-DECADIENYL-COA] == * smiles: ** CCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=T2-C4-DECADIENYL-COA T2-C4-DECADIENYL-COA] == |
| + | * smiles: | ||
| + | ** CCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ||
| + | * inchi key: | ||
| + | ** InChIKey=FASAKYLWSRDQOH-IMVFQKDNSA-J | ||
| + | * common name: | ||
| + | ** trans-Δ2, cis-Δ4-decadienoyl-CoA | ||
| + | * molecular weight: | ||
| + | ** 913.722 | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[RXN | + | * [[DIENOYLCOAREDUCT-RXN]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == | + | == Reaction(s) of unknown directionality == |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658212 90658212] |
| − | {{#set: | + | {{#set: smiles=CCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
| + | {{#set: inchi key=InChIKey=FASAKYLWSRDQOH-IMVFQKDNSA-J}} | ||
| + | {{#set: common name=trans-Δ2, cis-Δ4-decadienoyl-CoA}} | ||
| + | {{#set: molecular weight=913.722 }} | ||
| + | {{#set: consumed by=DIENOYLCOAREDUCT-RXN}} | ||
Revision as of 21:42, 17 March 2018
Contents
Metabolite T2-C4-DECADIENYL-COA
- smiles:
- CCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=FASAKYLWSRDQOH-IMVFQKDNSA-J
- common name:
- trans-Δ2, cis-Δ4-decadienoyl-CoA
- molecular weight:
- 913.722
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
