Difference between revisions of "4-HYDROXY-2-KETOPIMELATE-LYSIS-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHE PHE] == * smiles: ** C([O-])(=O)C([N+])CC1(C=CC=CC=1) * inchi key: ** InChIKey=COLNVLDHVKWL...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN] == * direction: ** LEFT-...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** GHMP kinase, C-terminal domain |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/4.1.1.33 EC-4.1.1.33] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[ATP]][c] '''+''' 1 [[CPD-641]][c] '''=>''' 1 [[DELTA3-ISOPENTENYL-PP]][c] '''+''' 1 [[Pi]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[ADP]][c] |
− | * [[ | + | * With common name(s): |
− | + | ** 1 ATP[c] '''+''' 1 (R)-mevalonate diphosphate[c] '''=>''' 1 isopentenyl diphosphate[c] '''+''' 1 phosphate[c] '''+''' 1 CO2[c] '''+''' 1 ADP[c] | |
− | == | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
− | * [[ | + | * [[Ec-21_001440]] |
+ | ** ESILICULOSUS_GENOME | ||
+ | ***EC-NUMBER | ||
+ | ** [[pantograph]]-[[aragem]] | ||
+ | == Pathways == | ||
+ | * [[PWY-922]], mevalonate pathway I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-922 PWY-922] | ||
+ | ** '''7''' reactions found over '''7''' reactions in the full pathway | ||
+ | * [[PWY-7391]], isoprene biosynthesis II (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7391 PWY-7391] | ||
+ | ** '''7''' reactions found over '''8''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=23732 23732] | |
− | + | * LIGAND-RXN: | |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01121 R01121] |
− | + | * UNIPROT: | |
− | * LIGAND- | + | ** [http://www.uniprot.org/uniprot/P32377 P32377] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.uniprot.org/uniprot/Q9U2A1 Q9U2A1] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9U294 Q9U294] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/O13963 O13963] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9M381 Q9M381] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O23722 O23722] |
− | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | {{#set: | + | {{#set: common name=GHMP kinase, C-terminal domain}} |
− | {{#set: | + | {{#set: ec number=EC-4.1.1.33}} |
− | {{#set: | + | {{#set: gene associated=Ec-21_001440}} |
− | {{#set: | + | {{#set: in pathway=PWY-922|PWY-7391}} |
− | {{#set: | + | {{#set: reconstruction category=orthology|annotation}} |
+ | {{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Revision as of 21:44, 17 March 2018
Contents
Reaction DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- GHMP kinase, C-terminal domain
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 ATP[c] + 1 CPD-641[c] => 1 DELTA3-ISOPENTENYL-PP[c] + 1 Pi[c] + 1 CARBON-DIOXIDE[c] + 1 ADP[c]
- With common name(s):
- 1 ATP[c] + 1 (R)-mevalonate diphosphate[c] => 1 isopentenyl diphosphate[c] + 1 phosphate[c] + 1 CO2[c] + 1 ADP[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Ec-21_001440
- ESILICULOSUS_GENOME
- EC-NUMBER
- pantograph-aragem
- ESILICULOSUS_GENOME
Pathways
- PWY-922, mevalonate pathway I: PWY-922
- 7 reactions found over 7 reactions in the full pathway
- PWY-7391, isoprene biosynthesis II (engineered): PWY-7391
- 7 reactions found over 8 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-aragem
- Tool: pantograph
- Source: orthology-aragem
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links