Difference between revisions of "Propionyl-CoA-CO2-ligases"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7221 CPD-7221] == * smiles: ** CCCCCCCCC=CCC(SCCNC(CCNC(C(C(COP(OP(OCC3(C(OP(=O)([O-])[O-])...")
 
(Created page with "Category:Gene == Gene Ec-06_001090 == * left end position: ** 727586 * transcription direction: ** POSITIVE * right end position: ** 734509 * centisome position: ** 8.3079...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7221 CPD-7221] ==
+
== Gene Ec-06_001090 ==
−
* smiles:
+
* left end position:
−
** CCCCCCCCC=CCC(SCCNC(CCNC(C(C(COP(OP(OCC3(C(OP(=O)([O-])[O-])C(O)C(N2(C1(N=CN=C(N)C=1N=C2)))O3))(=O)[O-])(=O)[O-])(C)C)O)=O)=O)=O
+
** 727586
−
* inchi key:
+
* transcription direction:
−
** InChIKey=XEMIVMKTVGRFTD-QXMHVHEDSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 3-cis-dodecenoyl-CoA
+
** 734509
−
* molecular weight:
+
* centisome position:
−
** 943.792    
+
** 8.307902    
 
* Synonym(s):
 
* Synonym(s):
−
** 12:1(n-9)
+
** Esi_0279_0022
−
** 12:1 cis-3
+
** Esi0279_0022
−
** cis-3-dodecenoyl-CoA
+
** IPS
−
** (3Z)-dodecenoyl-CoA
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[MYO-INOSITOL-1-PHOSPHATE-SYNTHASE-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** esiliculosus_genome
−
* [[RXN-7931]]
+
***ec-number
 +
* [[RXN66-579]]
 +
** esiliculosus_genome
 +
***ec-number
 +
== Pathways associated ==
 +
* [[PWY-2301]]
 +
* [[PWY-4661]]
 +
* [[PWY-6580]]
 +
* [[PWY-6664]]
 +
* [[PWY1G-0]]
 +
* [[PWY-6372]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=727586}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659197 90659197]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=734509}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27989 27989]
+
{{#set: centisome position=8.307902   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0279_0022|Esi0279_0022|IPS}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02944 C02944]
+
{{#set: reaction associated=MYO-INOSITOL-1-PHOSPHATE-SYNTHASE-RXN|RXN66-579}}
−
* HMDB : HMDB04257
+
{{#set: pathway associated=PWY-2301|PWY-4661|PWY-6580|PWY-6664|PWY1G-0|PWY-6372}}
−
{{#set: smiles=CCCCCCCCC=CCC(SCCNC(CCNC(C(C(COP(OP(OCC3(C(OP(=O)([O-])[O-])C(O)C(N2(C1(N=CN=C(N)C=1N=C2)))O3))(=O)[O-])(=O)[O-])(C)C)O)=O)=O)=O}}
+
−
{{#set: inchi key=InChIKey=XEMIVMKTVGRFTD-QXMHVHEDSA-J}}
+
−
{{#set: common name=3-cis-dodecenoyl-CoA}}
+
−
{{#set: molecular weight=943.792   }}
+
−
{{#set: common name=12:1(n-9)|12:1 cis-3|cis-3-dodecenoyl-CoA|(3Z)-dodecenoyl-CoA}}
+
−
{{#set: consumed or produced by=RXN-7931}}
+

Revision as of 21:45, 17 March 2018

Gene Ec-06_001090

  • left end position:
    • 727586
  • transcription direction:
    • POSITIVE
  • right end position:
    • 734509
  • centisome position:
    • 8.307902
  • Synonym(s):
    • Esi_0279_0022
    • Esi0279_0022
    • IPS

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Propionyl-CoA-CO2-ligases&oldid=14348"