Difference between revisions of "RXN-12521"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-308 CPD-308] == * smiles: ** C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O * inchi...") |
(Created page with "Category:Gene == Gene Ec-08_000860 == * left end position: ** 851507 * transcription direction: ** NEGATIVE * right end position: ** 864783 * centisome position: ** 12.714...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-08_000860 == |
− | * | + | * left end position: |
− | ** | + | ** 851507 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 864783 |
− | * | + | * centisome position: |
− | ** | + | ** 12.714627 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0214_0024 |
+ | ** Esi0214_0024 | ||
− | == | + | == Reactions associated == |
− | + | * [[4.2.2.10-RXN]] | |
− | * [[ | + | ** esiliculosus_genome |
− | == | + | ***automated-name-match |
+ | * [[RXN-14897]] | ||
+ | ** esiliculosus_genome | ||
+ | ***automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7243]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=851507}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=864783}} | |
− | + | {{#set: centisome position=12.714627 }} | |
− | + | {{#set: common name=Esi_0214_0024|Esi0214_0024}} | |
− | + | {{#set: reaction associated=4.2.2.10-RXN|RXN-14897}} | |
− | {{#set: | + | {{#set: pathway associated=PWY-7243}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 21:45, 17 March 2018
Gene Ec-08_000860
- left end position:
- 851507
- transcription direction:
- NEGATIVE
- right end position:
- 864783
- centisome position:
- 12.714627
- Synonym(s):
- Esi_0214_0024
- Esi0214_0024
Reactions associated
- 4.2.2.10-RXN
- esiliculosus_genome
- automated-name-match
- esiliculosus_genome
- RXN-14897
- esiliculosus_genome
- automated-name-match
- esiliculosus_genome