Difference between revisions of "CPD-16475"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15684 CPD-15684] == * smiles: ** CCCCCCC=CC=CCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...")
 
(Created page with "Category:Gene == Gene Ec-06_004310 == * left end position: ** 3585203 * transcription direction: ** NEGATIVE * right end position: ** 3589358 * centisome position: ** 40.9...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15684 CPD-15684] ==
+
== Gene Ec-06_004310 ==
−
* smiles:
+
* left end position:
−
** CCCCCCC=CC=CCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 3585203
−
* inchi key:
+
* transcription direction:
−
** InChIKey=AMANZGDVBADZLH-QTJPLKLFSA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 5-cis, 7-trans-tetradecadienoyl-CoA
+
** 3589358
−
* molecular weight:
+
* centisome position:
−
** 969.83    
+
** 40.937454    
 
* Synonym(s):
 
* Synonym(s):
−
** 5Z, 7E-tetradecadienoyl-CoA
+
** Esi_0062_0090
 +
** Esi0062_0090
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-14796]]
+
* [[ATPASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** [[pantograph]]-[[aragem]]
−
== Reaction(s) of unknown directionality ==
+
* [[ATPSYN-RXN]]
 +
** esiliculosus_genome
 +
***go-term
 +
== Pathways associated ==
 +
* [[PWY-7219]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3585203}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659270 90659270]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=CCCCCCC=CC=CCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: right end position=3589358}}
−
{{#set: inchi key=InChIKey=AMANZGDVBADZLH-QTJPLKLFSA-J}}
+
{{#set: centisome position=40.937454   }}
−
{{#set: common name=5-cis, 7-trans-tetradecadienoyl-CoA}}
+
{{#set: common name=Esi_0062_0090|Esi0062_0090}}
−
{{#set: molecular weight=969.83   }}
+
{{#set: reaction associated=ATPASE-RXN|ATPSYN-RXN}}
−
{{#set: common name=5Z, 7E-tetradecadienoyl-CoA}}
+
{{#set: pathway associated=PWY-7219}}
−
{{#set: consumed by=RXN-14796}}
+

Revision as of 21:45, 17 March 2018

Gene Ec-06_004310

  • left end position:
    • 3585203
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 3589358
  • centisome position:
    • 40.937454
  • Synonym(s):
    • Esi_0062_0090
    • Esi0062_0090

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-16475&oldid=14356"