|
|
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3PGAREARR-RXN 3PGAREARR-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXINE-5P PYRIDOXINE-5P] == |
− | * direction: | + | * smiles: |
− | ** REVERSIBLE | + | ** CC1(=NC=C(COP([O-])(=O)[O-])C(=C(O)1)CO) |
| + | * inchi key: |
| + | ** InChIKey=WHOMFKWHIQZTHY-UHFFFAOYSA-L |
| * common name: | | * common name: |
− | ** phosphoglycerate mutase | + | ** pyridoxine 5'-phosphate |
− | * ec number: | + | * molecular weight: |
− | ** [http://enzyme.expasy.org/EC/5.4.2.12 EC-5.4.2.12] | + | ** 247.144 |
| * Synonym(s): | | * Synonym(s): |
| + | ** pyridoxol 5'-phosphate |
| + | ** pyridoxine 5-phosphate |
| + | ** pyridoxine phosphate |
| + | ** pyridoxine-5P |
| + | ** pyridoxine-P |
| + | ** [5-hydroxy-4-(hydroxymethyl)-6-methylpyridin-3-yl]methyl phosphate |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | * [[PNPOXI-RXN]] |
− | ** 1 [[2-PG]][c] '''<=>''' 1 [[G3P]][c]
| + | == Reaction(s) known to produce the compound == |
− | * With common name(s):
| + | * [[PNKIN-RXN]] |
− | ** 1 2-phospho-D-glycerate[c] '''<=>''' 1 3-phospho-D-glycerate[c]
| + | == Reaction(s) of unknown directionality == |
− | | + | |
− | == Genes associated with this reaction ==
| + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Ec-06_009930]]
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | * [[Ec-10_005410]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***GO-TERM
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | * [[Ec-24_002670]]
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | * [[Ec-03_002170]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***GO-TERM
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | * [[Ec-03_002160]]
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | * [[Ec-27_000330]]
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | * [[Ec-01_000980]]
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | == Pathways ==
| + | |
− | * [[PWY-1042]], glycolysis IV (plant cytosol): [http://metacyc.org/META/NEW-IMAGE?object=PWY-1042 PWY-1042]
| + | |
− | ** '''8''' reactions found over '''10''' reactions in the full pathway
| + | |
− | * [[P341-PWY]], glycolysis V (Pyrococcus): [http://metacyc.org/META/NEW-IMAGE?object=P341-PWY P341-PWY]
| + | |
− | ** '''6''' reactions found over '''9''' reactions in the full pathway
| + | |
− | * [[PWY-2221]], Entner-Doudoroff pathway III (semi-phosphorylative): [http://metacyc.org/META/NEW-IMAGE?object=PWY-2221 PWY-2221]
| + | |
− | ** '''5''' reactions found over '''9''' reactions in the full pathway
| + | |
− | * [[GLUCONEO-PWY]], gluconeogenesis I: [http://metacyc.org/META/NEW-IMAGE?object=GLUCONEO-PWY GLUCONEO-PWY] | + | |
− | ** '''13''' reactions found over '''13''' reactions in the full pathway
| + | |
− | * [[GLYCOLYSIS]], glycolysis I (from glucose 6-phosphate): [http://metacyc.org/META/NEW-IMAGE?object=GLYCOLYSIS GLYCOLYSIS]
| + | |
− | ** '''12''' reactions found over '''12''' reactions in the full pathway
| + | |
− | * [[PWY-6901]], superpathway of glucose and xylose degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6901 PWY-6901]
| + | |
− | ** '''9''' reactions found over '''12''' reactions in the full pathway
| + | |
− | * [[PWY-7218]], photosynthetic 3-hydroxybutanoate biosynthesis (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7218 PWY-7218]
| + | |
− | ** '''7''' reactions found over '''10''' reactions in the full pathway
| + | |
− | * [[P124-PWY]], Bifidobacterium shunt: [http://metacyc.org/META/NEW-IMAGE?object=P124-PWY P124-PWY]
| + | |
− | ** '''12''' reactions found over '''15''' reactions in the full pathway
| + | |
− | * [[PWY-6886]], 1-butanol autotrophic biosynthesis (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6886 PWY-6886]
| + | |
− | ** '''8''' reactions found over '''11''' reactions in the full pathway
| + | |
− | * [[PWY-5723]], Rubisco shunt: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5723 PWY-5723] | + | |
− | ** '''10''' reactions found over '''10''' reactions in the full pathway
| + | |
− | * [[PWY-6142]], gluconeogenesis II (Methanobacterium thermoautotrophicum): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6142 PWY-6142]
| + | |
− | ** '''10''' reactions found over '''14''' reactions in the full pathway
| + | |
− | * [[PWY-5484]], glycolysis II (from fructose 6-phosphate): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5484 PWY-5484]
| + | |
− | ** '''11''' reactions found over '''11''' reactions in the full pathway
| + | |
− | * [[PWY-7124]], ethylene biosynthesis V (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7124 PWY-7124]
| + | |
− | ** '''8''' reactions found over '''10''' reactions in the full pathway
| + | |
− | * [[PWY-7003]], glycerol degradation to butanol: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7003 PWY-7003]
| + | |
− | ** '''8''' reactions found over '''10''' reactions in the full pathway
| + | |
− | == Reconstruction information ==
| + | |
− | * [[orthology]]:
| + | |
− | ** [[pantograph]]:
| + | |
− | *** [[aragem]]
| + | |
− | * [[annotation]]:
| + | |
− | ** [[pathwaytools]]:
| + | |
− | *** [[esiliculosus_genome]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * CAS : 447-05-2 |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=15901 15901]
| + | * BIGG : 35527 |
− | * LIGAND-RXN:
| + | * PUBCHEM: |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R01518 R01518]
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=24794348 24794348] |
− | * UNIPROT: | + | * HMDB : HMDB01319 |
− | ** [http://www.uniprot.org/uniprot/P30792 P30792] | + | * LIGAND-CPD: |
− | ** [http://www.uniprot.org/uniprot/P52832 P52832] | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00627 C00627] |
− | ** [http://www.uniprot.org/uniprot/P44865 P44865]
| + | * CHEBI: |
− | ** [http://www.uniprot.org/uniprot/P30798 P30798]
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58589 58589] |
− | ** [http://www.uniprot.org/uniprot/P62707 P62707] | + | * METABOLIGHTS : MTBLC58589 |
− | ** [http://www.uniprot.org/uniprot/P39773 P39773] | + | {{#set: smiles=CC1(=NC=C(COP([O-])(=O)[O-])C(=C(O)1)CO)}} |
− | ** [http://www.uniprot.org/uniprot/P47669 P47669] | + | {{#set: inchi key=InChIKey=WHOMFKWHIQZTHY-UHFFFAOYSA-L}} |
− | ** [http://www.uniprot.org/uniprot/Q9CEU3 Q9CEU3] | + | {{#set: common name=pyridoxine 5'-phosphate}} |
− | ** [http://www.uniprot.org/uniprot/P56196 P56196] | + | {{#set: molecular weight=247.144 }} |
− | ** [http://www.uniprot.org/uniprot/Q9JTF2 Q9JTF2]
| + | {{#set: common name=pyridoxol 5'-phosphate|pyridoxine 5-phosphate|pyridoxine phosphate|pyridoxine-5P|pyridoxine-P|[5-hydroxy-4-(hydroxymethyl)-6-methylpyridin-3-yl]methyl phosphate}} |
− | ** [http://www.uniprot.org/uniprot/Q9PI71 Q9PI71]
| + | {{#set: consumed by=PNPOXI-RXN}} |
− | ** [http://www.uniprot.org/uniprot/Q9CIM0 Q9CIM0] | + | {{#set: produced by=PNKIN-RXN}} |
− | ** [http://www.uniprot.org/uniprot/P00950 P00950]
| + | |
− | ** [http://www.uniprot.org/uniprot/P18669 P18669]
| + | |
− | ** [http://www.uniprot.org/uniprot/P15259 P15259]
| + | |
− | ** [http://www.uniprot.org/uniprot/P16290 P16290]
| + | |
− | ** [http://www.uniprot.org/uniprot/P35167 P35167]
| + | |
− | ** [http://www.uniprot.org/uniprot/P33158 P33158]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q06464 Q06464]
| + | |
− | ** [http://www.uniprot.org/uniprot/P36623 P36623]
| + | |
− | ** [http://www.uniprot.org/uniprot/P35494 P35494]
| + | |
− | ** [http://www.uniprot.org/uniprot/P37689 P37689]
| + | |
− | ** [http://www.uniprot.org/uniprot/P35493 P35493]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9VAN7 Q9VAN7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42908 Q42908]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q12326 Q12326]
| + | |
− | ** [http://www.uniprot.org/uniprot/P53531 P53531]
| + | |
− | ** [http://www.uniprot.org/uniprot/P51379 P51379]
| + | |
− | ** [http://www.uniprot.org/uniprot/P75167 P75167]
| + | |
− | ** [http://www.uniprot.org/uniprot/P72649 P72649]
| + | |
− | ** [http://www.uniprot.org/uniprot/P74507 P74507]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q49006 Q49006]
| + | |
− | ** [http://www.uniprot.org/uniprot/O24246 O24246]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9X519 Q9X519]
| + | |
− | {{#set: direction=REVERSIBLE}} | + | |
− | {{#set: common name=phosphoglycerate mutase}} | + | |
− | {{#set: ec number=EC-5.4.2.12}} | + | |
− | {{#set: gene associated=Ec-06_009930|Ec-10_005410|Ec-24_002670|Ec-03_002170|Ec-03_002160|Ec-27_000330|Ec-01_000980}} | + | |
− | {{#set: in pathway=PWY-1042|P341-PWY|PWY-2221|GLUCONEO-PWY|GLYCOLYSIS|PWY-6901|PWY-7218|P124-PWY|PWY-6886|PWY-5723|PWY-6142|PWY-5484|PWY-7124|PWY-7003}} | + | |
− | {{#set: reconstruction category=orthology}} | + | |
− | {{#set: reconstruction tool=pantograph}} | + | |
− | {{#set: reconstruction source=aragem}}
| + | |
− | {{#set: reconstruction category=annotation}}
| + | |
− | {{#set: reconstruction tool=pathwaytools}}
| + | |
− | {{#set: reconstruction source=esiliculosus_genome}}
| + | |