Difference between revisions of "2-Hexadecenoyl-ACPs"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CITRULLINE L-CITRULLINE] == * smiles: ** C(NC(N)=O)CCC([N+])C(=O)[O-] * inchi key: ** InChIKe...") |
(Created page with "Category:Gene == Gene Ec-15_004950 == * left end position: ** 5303079 * transcription direction: ** POSITIVE * right end position: ** 5308267 * centisome position: ** 98.2...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-15_004950 == |
− | * | + | * left end position: |
− | ** | + | ** 5303079 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 5308267 |
− | * | + | * centisome position: |
− | ** | + | ** 98.236946 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0156_0051 |
− | ** | + | ** Esi0156_0051 |
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[2.7.10.1-RXN]] |
− | + | ** esiliculosus_genome | |
− | + | ***automated-name-match | |
− | * | + | * [[PROTEIN-KINASE-RXN]] |
− | * [[ | + | ** esiliculosus_genome |
+ | ***go-term | ||
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=5303079}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=5308267}} | |
− | + | {{#set: centisome position=98.236946 }} | |
− | + | {{#set: common name=Esi_0156_0051|Esi0156_0051}} | |
− | + | {{#set: reaction associated=2.7.10.1-RXN|PROTEIN-KINASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + |
Revision as of 21:46, 17 March 2018
Gene Ec-15_004950
- left end position:
- 5303079
- transcription direction:
- POSITIVE
- right end position:
- 5308267
- centisome position:
- 98.236946
- Synonym(s):
- Esi_0156_0051
- Esi0156_0051
Reactions associated
- 2.7.10.1-RXN
- esiliculosus_genome
- automated-name-match
- esiliculosus_genome
- PROTEIN-KINASE-RXN
- esiliculosus_genome
- go-term
- esiliculosus_genome