Difference between revisions of "Ec-06 003440"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14426 CPD-14426] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C...")
 
(Created page with "Category:Gene == Gene Ec-28_000110 == * left end position: ** 128098 * transcription direction: ** NEGATIVE * right end position: ** 139480 * centisome position: ** 3.3807...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14426 CPD-14426] ==
+
== Gene Ec-28_000110 ==
−
* smiles:
+
* left end position:
−
** CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 128098
−
* inchi key:
+
* transcription direction:
−
** InChIKey=NDRVWKXEWNMEEO-HVGANWHPSA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** docosapentaenoyl-CoA
+
** 139480
−
* molecular weight:
+
* centisome position:
−
** 1075.997    
+
** 3.3807688    
 
* Synonym(s):
 
* Synonym(s):
−
** (7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoyl-CoA
+
** Esi_0120_0020
−
** (7Z,10Z,13Z,16Z,19Z)-docosapentaenoyl-CoA
+
** Esi0120_0020
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-16082]]
+
* [[RXN-13398]]
−
== Reaction(s) known to produce the compound ==
+
** esiliculosus_genome
−
* [[RXN-13445]]
+
***go-term
−
== Reaction(s) of unknown directionality ==
+
* [[RXN-7676]]
 +
** esiliculosus_genome
 +
***go-term
 +
* [[RXN-7677]]
 +
** esiliculosus_genome
 +
***go-term
 +
== Pathways associated ==
 +
* [[PWY-5068]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=128098}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581114 71581114]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=139480}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73870 73870]
+
{{#set: centisome position=3.3807688   }}
−
{{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: common name=Esi_0120_0020|Esi0120_0020}}
−
{{#set: inchi key=InChIKey=NDRVWKXEWNMEEO-HVGANWHPSA-J}}
+
{{#set: reaction associated=RXN-13398|RXN-7676|RXN-7677}}
−
{{#set: common name=docosapentaenoyl-CoA}}
+
{{#set: pathway associated=PWY-5068}}
−
{{#set: molecular weight=1075.997   }}
+
−
{{#set: common name=(7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoyl-CoA|(7Z,10Z,13Z,16Z,19Z)-docosapentaenoyl-CoA}}
+
−
{{#set: consumed by=RXN-16082}}
+
−
{{#set: produced by=RXN-13445}}
+

Revision as of 21:46, 17 March 2018

Gene Ec-28_000110

  • left end position:
    • 128098
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 139480
  • centisome position:
    • 3.3807688
  • Synonym(s):
    • Esi_0120_0020
    • Esi0120_0020

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-06_003440&oldid=14382"