Difference between revisions of "Ec-24 002770"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-07_000890 == * left end position: ** 981277 * transcription direction: ** POSITIVE * right end position: ** 994828 * centisome position: ** 12.706...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-695 CPD-695] == * smiles: ** C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Ec-07_000890 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-695 CPD-695] ==
* left end position:
+
* smiles:
** 981277
+
** C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
* transcription direction:
+
* inchi key:
** POSITIVE
+
** InChIKey=CZEMYYICWZPENF-VOLTXKGXSA-L
* right end position:
+
* common name:
** 994828
+
** gibberellin A53
* centisome position:
+
* molecular weight:
** 12.706843    
+
** 346.422    
 
* Synonym(s):
 
* Synonym(s):
** Esi_0045_0025
+
** GA53
** Esi0045_0025
+
** MEP21
+
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[RXN-9839]]
+
* [[RXN1F-167]]
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
***automated-name-match
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
* [[PWY-6082]]
+
* [[PWY-6073]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=981277}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203620 25203620]
{{#set: right end position=994828}}
+
* CHEBI:
{{#set: centisome position=12.706843   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27433 27433]
{{#set: common name=Esi_0045_0025|Esi0045_0025|MEP21}}
+
* LIGAND-CPD:
{{#set: reaction associated=RXN-9839}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C06094 C06094]
{{#set: pathway associated=PWY-6082|PWY-6073}}
+
* HMDB : HMDB36895
 +
{{#set: smiles=C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}}
 +
{{#set: inchi key=InChIKey=CZEMYYICWZPENF-VOLTXKGXSA-L}}
 +
{{#set: common name=gibberellin A53}}
 +
{{#set: molecular weight=346.422   }}
 +
{{#set: common name=GA53}}
 +
{{#set: consumed by=RXN1F-167}}

Revision as of 21:46, 17 March 2018

Metabolite CPD-695

  • smiles:
    • C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
  • inchi key:
    • InChIKey=CZEMYYICWZPENF-VOLTXKGXSA-L
  • common name:
    • gibberellin A53
  • molecular weight:
    • 346.422
  • Synonym(s):
    • GA53

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))" cannot be used as a page name in this wiki.