Difference between revisions of "TREHALA-RXN"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-11_006010 == * left end position: ** 6018607 * transcription direction: ** NEGATIVE * right end position: ** 6018891 * centisome position: ** 95.6...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNOSE-1P MANNOSE-1P] == * smiles: ** C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1) * inchi key: *...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNOSE-1P MANNOSE-1P] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=HXXFSFRBOHSIMQ-RWOPYEJCSA-L |
| − | * | + | * common name: |
| − | ** | + | ** α-D-mannose 1-phosphate |
| − | * | + | * molecular weight: |
| − | ** | + | ** 258.121 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** mannose-1-phosphate |
| − | ** | + | ** D-mannose-1-phosphate |
| + | ** mannose-1-P | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[2.7.7.13-RXN]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | * [[ | + | * [[PHOSMANMUT-RXN]] |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 27251-84-9 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245607 25245607] |
| − | {{#set: | + | * HMDB : HMDB06330 |
| − | {{#set: common name= | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00636 C00636] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58409 58409] | ||
| + | * BIGG : 42578 | ||
| + | {{#set: smiles=C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)}} | ||
| + | {{#set: inchi key=InChIKey=HXXFSFRBOHSIMQ-RWOPYEJCSA-L}} | ||
| + | {{#set: common name=α-D-mannose 1-phosphate}} | ||
| + | {{#set: molecular weight=258.121 }} | ||
| + | {{#set: common name=mannose-1-phosphate|D-mannose-1-phosphate|mannose-1-P}} | ||
| + | {{#set: consumed by=2.7.7.13-RXN}} | ||
| + | {{#set: reversible reaction associated=PHOSMANMUT-RXN}} | ||
Revision as of 21:47, 17 March 2018
Contents
Metabolite MANNOSE-1P
- smiles:
- C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)
- inchi key:
- InChIKey=HXXFSFRBOHSIMQ-RWOPYEJCSA-L
- common name:
- α-D-mannose 1-phosphate
- molecular weight:
- 258.121
- Synonym(s):
- mannose-1-phosphate
- D-mannose-1-phosphate
- mannose-1-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)" cannot be used as a page name in this wiki.
