Difference between revisions of "Ec-21 001090"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ANTHRANILATE ANTHRANILATE] == * smiles: ** C(C1(C(=CC=CC=1)N))(=O)[O-] * inchi key: ** InChIKey...") |
(Created page with "Category:Gene == Gene Ec-09_003950 == * left end position: ** 4487596 * transcription direction: ** POSITIVE * right end position: ** 4499362 * centisome position: ** 79.9...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-09_003950 == |
− | * | + | * left end position: |
− | ** | + | ** 4487596 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 4499362 |
− | * | + | * centisome position: |
− | ** | + | ** 79.947754 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0303_0025 |
− | ** | + | ** Esi0303_0025 |
− | ** | + | ** MEP3 |
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | + | * [[RXN-9839]] | |
− | == | + | ** esiliculosus_genome |
− | * [[ | + | ***automated-name-match |
− | * [[ | + | == Pathways associated == |
+ | * [[PWY-6082]] | ||
+ | * [[PWY-6073]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=4487596}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=4499362}} | |
− | + | {{#set: centisome position=79.947754 }} | |
− | + | {{#set: common name=Esi_0303_0025|Esi0303_0025|MEP3}} | |
− | + | {{#set: reaction associated=RXN-9839}} | |
− | + | {{#set: pathway associated=PWY-6082|PWY-6073}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 21:47, 17 March 2018
Gene Ec-09_003950
- left end position:
- 4487596
- transcription direction:
- POSITIVE
- right end position:
- 4499362
- centisome position:
- 79.947754
- Synonym(s):
- Esi_0303_0025
- Esi0303_0025
- MEP3
Reactions associated
- RXN-9839
- esiliculosus_genome
- automated-name-match
- esiliculosus_genome