Difference between revisions of "TTP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PANTOTHENATE PANTOTHENATE] == * smiles: ** CC(C)(CO)C(O)C(=O)NCCC(=O)[O-] * inchi key: ** InChI...")
 
(Created page with "Category:Gene == Gene Ec-24_004010 == * left end position: ** 4458078 * transcription direction: ** NEGATIVE * right end position: ** 4463066 * centisome position: ** 89.3...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PANTOTHENATE PANTOTHENATE] ==
+
== Gene Ec-24_004010 ==
−
* smiles:
+
* left end position:
−
** CC(C)(CO)C(O)C(=O)NCCC(=O)[O-]
+
** 4458078
−
* inchi key:
+
* transcription direction:
−
** InChIKey=GHOKWGTUZJEAQD-ZETCQYMHSA-M
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** (R)-pantothenate
+
** 4463066
−
* molecular weight:
+
* centisome position:
−
** 218.229    
+
** 89.38194    
 
* Synonym(s):
 
* Synonym(s):
−
** vitamin B5
+
** Esi_0109_0058
−
** (R)-pantothenic acid
+
** Esi0109_0058
−
** D-pantothenic acid
+
** SR
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[PANTOTHENATE-KIN-RXN]]
+
* [[5.1.1.16-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** esiliculosus_genome
−
* [[PANTOATE-BETA-ALANINE-LIG-RXN]]
+
***ec-number
−
== Reaction(s) of unknown directionality ==
+
* [[RXN0-2381]]
 +
** esiliculosus_genome
 +
***automated-name-match
 +
* [[RXN0-2382]]
 +
** esiliculosus_genome
 +
***automated-name-match
 +
* [[TRYPSYN-RXN]]
 +
** esiliculosus_genome
 +
***automated-name-match
 +
== Pathways associated ==
 +
* [[TRPSYN-PWY]]
 +
* [[PWY-6949]]
 
== External links  ==
 
== External links  ==
−
* CAS : 79-83-4
+
{{#set: left end position=4458078}}
−
* Wikipedia : Vitamin_B5
+
{{#set: transcription direction=NEGATIVE}}
−
* PUBCHEM:
+
{{#set: right end position=4463066}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=167945 167945]
+
{{#set: centisome position=89.38194   }}
−
* HMDB : HMDB00210
+
{{#set: common name=Esi_0109_0058|Esi0109_0058|SR}}
−
* LIGAND-CPD:
+
{{#set: reaction associated=5.1.1.16-RXN|RXN0-2381|RXN0-2382|TRYPSYN-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00864 C00864]
+
{{#set: pathway associated=TRPSYN-PWY|PWY-6949}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.146912.html 146912]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29032 29032]
+
−
* BIGG : 36234
+
−
{{#set: smiles=CC(C)(CO)C(O)C(=O)NCCC(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=GHOKWGTUZJEAQD-ZETCQYMHSA-M}}
+
−
{{#set: common name=(R)-pantothenate}}
+
−
{{#set: molecular weight=218.229   }}
+
−
{{#set: common name=vitamin B5|(R)-pantothenic acid|D-pantothenic acid}}
+
−
{{#set: consumed by=PANTOTHENATE-KIN-RXN}}
+
−
{{#set: produced by=PANTOATE-BETA-ALANINE-LIG-RXN}}
+

Revision as of 21:47, 17 March 2018

Gene Ec-24_004010

  • left end position:
    • 4458078
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 4463066
  • centisome position:
    • 89.38194
  • Synonym(s):
    • Esi_0109_0058
    • Esi0109_0058
    • SR

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=TTP&oldid=14463"