Difference between revisions of "Ec-17 002880"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-14_003270 == * left end position: ** 3078725 * transcription direction: ** POSITIVE * right end position: ** 3088383 * centisome position: ** 46.9...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-KETOLACTOSE 3-KETOLACTOSE] == * smiles: ** C(O)C2(OC(OC1(C(CO)OC(O)C(O)C(O)1))C(O)C(=O)C(O)2)...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-14_003270 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-KETOLACTOSE 3-KETOLACTOSE] ==
−
* left end position:
+
* smiles:
−
** 3078725
+
** C(O)C2(OC(OC1(C(CO)OC(O)C(O)C(O)1))C(O)C(=O)C(O)2)
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=HKKHTABTHSUDBP-GIHCHDTPSA-N
−
* right end position:
+
* common name:
−
** 3088383
+
** 3'-ketolactose
−
* centisome position:
+
* molecular weight:
−
** 46.928722    
+
** 340.283    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0089_0106
+
** 3'-dehydro-β-D-galactosyl-β-D-glucopyranoside
−
** Esi0089_0106
+
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[2.4.1.229-RXN]]
+
* [[KETOLACTOSE-RXN]]
−
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=3078725}}
+
* CHEBI:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27571 27571]
−
{{#set: right end position=3088383}}
+
* KEGG-GLYCAN : G10531
−
{{#set: centisome position=46.928722   }}
+
* LIGAND-CPD:
−
{{#set: common name=Esi_0089_0106|Esi0089_0106}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C05403 C05403]
−
{{#set: reaction associated=2.4.1.229-RXN}}
+
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201057 25201057]
 +
* HMDB : HMDB01030
 +
{{#set: smiles=C(O)C2(OC(OC1(C(CO)OC(O)C(O)C(O)1))C(O)C(=O)C(O)2)}}
 +
{{#set: inchi key=InChIKey=HKKHTABTHSUDBP-GIHCHDTPSA-N}}
 +
{{#set: common name=3'-ketolactose}}
 +
{{#set: molecular weight=340.283   }}
 +
{{#set: common name=3'-dehydro-β-D-galactosyl-β-D-glucopyranoside}}
 +
{{#set: consumed by=KETOLACTOSE-RXN}}

Revision as of 21:47, 17 March 2018

Metabolite 3-KETOLACTOSE

  • smiles:
    • C(O)C2(OC(OC1(C(CO)OC(O)C(O)C(O)1))C(O)C(=O)C(O)2)
  • inchi key:
    • InChIKey=HKKHTABTHSUDBP-GIHCHDTPSA-N
  • common name:
    • 3'-ketolactose
  • molecular weight:
    • 340.283
  • Synonym(s):
    • 3'-dehydro-β-D-galactosyl-β-D-glucopyranoside

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-17_002880&oldid=14467"