Difference between revisions of "Cis-delta17-3-oxo-C36-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11715 CPD-11715] == * smiles: ** C(=O)(NCC(=O)[O-])CC1(C=CC=CC=1) * inchi key: ** InChIKey=...")
 
(Created page with "Category:Gene == Gene Ec-11_003480 == * left end position: ** 3556297 * transcription direction: ** NEGATIVE * right end position: ** 3564441 * centisome position: ** 56.5...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11715 CPD-11715] ==
+
== Gene Ec-11_003480 ==
−
* smiles:
+
* left end position:
−
** C(=O)(NCC(=O)[O-])CC1(C=CC=CC=1)
+
** 3556297
−
* inchi key:
+
* transcription direction:
−
** InChIKey=UTYVDVLMYQPLQB-UHFFFAOYSA-M
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** phenylacetylglycine
+
** 3564441
−
* molecular weight:
+
* centisome position:
−
** 192.194    
+
** 56.54198    
 
* Synonym(s):
 
* Synonym(s):
−
** phenaceturic acid
+
** Esi_0262_0026
−
** phenacetylglycine
+
** Esi0262_0026
−
** N-phenacetylglycine
+
** D1 protease prec
−
** N-phenylacetylglycine
+
−
** N-(phenylacetyl)glycine
+
−
** glycine, N-(phenylacetyl)-
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[3.4.21.102-RXN]]
−
* [[RXN-10821]]
+
** esiliculosus_genome
−
== Reaction(s) of unknown directionality ==
+
***automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3556297}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4229702 4229702]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEMSPIDER:
+
{{#set: right end position=3564441}}
−
** [http://www.chemspider.com/Chemical-Structure.3438658.html 3438658]
+
{{#set: centisome position=56.54198   }}
−
* CHEBI:
+
{{#set: common name=Esi_0262_0026|Esi0262_0026|D1 protease prec}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60874 60874]
+
{{#set: reaction associated=3.4.21.102-RXN}}
−
{{#set: smiles=C(=O)(NCC(=O)[O-])CC1(C=CC=CC=1)}}
+
−
{{#set: inchi key=InChIKey=UTYVDVLMYQPLQB-UHFFFAOYSA-M}}
+
−
{{#set: common name=phenylacetylglycine}}
+
−
{{#set: molecular weight=192.194   }}
+
−
{{#set: common name=phenaceturic acid|phenacetylglycine|N-phenacetylglycine|N-phenylacetylglycine|N-(phenylacetyl)glycine|glycine, N-(phenylacetyl)-}}
+
−
{{#set: produced by=RXN-10821}}
+

Revision as of 21:47, 17 March 2018

Gene Ec-11_003480

  • left end position:
    • 3556297
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 3564441
  • centisome position:
    • 56.54198
  • Synonym(s):
    • Esi_0262_0026
    • Esi0262_0026
    • D1 protease prec

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Cis-delta17-3-oxo-C36-ACPs&oldid=14493"