Difference between revisions of "Ec-11 002820"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6554 RXN0-6554] == * direction: ** LEFT-TO-RIGHT * common name: ** dihydroorotate dehydrogenas...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PSEUDOURIDINE-5-P PSEUDOURIDINE-5-P] == * smiles: ** C1(=C(C(=O)NC(=O)N1)C2(OC(COP(=O)([O-])[O-...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PSEUDOURIDINE-5-P PSEUDOURIDINE-5-P] == |
− | * | + | * smiles: |
− | ** | + | ** C1(=C(C(=O)NC(=O)N1)C2(OC(COP(=O)([O-])[O-])C(O)C(O)2)) |
+ | * inchi key: | ||
+ | ** InChIKey=MOBMOJGXNHLLIR-GBNDHIKLSA-L | ||
* common name: | * common name: | ||
− | ** | + | ** pseudouridine 5'-phosphate |
− | * | + | * molecular weight: |
− | ** | + | ** 322.168 |
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[PSEUDOURIDINE-KINASE-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN0-5398]] | |
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * CAS : 1157-60-4 | |
− | + | * PUBCHEM: | |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245232 25245232] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58380 58380] |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01168 C01168] |
− | {{#set: | + | * HMDB : HMDB01271 |
+ | {{#set: smiles=C1(=C(C(=O)NC(=O)N1)C2(OC(COP(=O)([O-])[O-])C(O)C(O)2))}} | ||
+ | {{#set: inchi key=InChIKey=MOBMOJGXNHLLIR-GBNDHIKLSA-L}} | ||
+ | {{#set: common name=pseudouridine 5'-phosphate}} | ||
+ | {{#set: molecular weight=322.168 }} | ||
+ | {{#set: produced by=PSEUDOURIDINE-KINASE-RXN}} | ||
+ | {{#set: reversible reaction associated=RXN0-5398}} |
Revision as of 21:48, 17 March 2018
Contents
Metabolite PSEUDOURIDINE-5-P
- smiles:
- C1(=C(C(=O)NC(=O)N1)C2(OC(COP(=O)([O-])[O-])C(O)C(O)2))
- inchi key:
- InChIKey=MOBMOJGXNHLLIR-GBNDHIKLSA-L
- common name:
- pseudouridine 5'-phosphate
- molecular weight:
- 322.168
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(=C(C(=O)NC(=O)N1)C2(OC(COP(=O)([O-])[O-])C(O)C(O)2))" cannot be used as a page name in this wiki.