Difference between revisions of "Ec-11 001530"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-06_002750 == * Synonym(s): ** Esi_0165_0035 ** Esi0165_0035 == Reactions associated == * ATPASE-RXN ** pantograph-aragem == Pathways...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11641 CPD-11641] == * smiles: ** CC3(C2(C=CC(OC1(OC(CO)C(O)C(O)C(O)1))=CC=2OC(=O)C=3)) * in...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Ec-06_002750 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11641 CPD-11641] ==
 +
* smiles:
 +
** CC3(C2(C=CC(OC1(OC(CO)C(O)C(O)C(O)1))=CC=2OC(=O)C=3))
 +
* inchi key:
 +
** InChIKey=YUDPTGPSBJVHCN-YMILTQATSA-N
 +
* common name:
 +
** 4-methylumbelliferyl glucoside
 +
* molecular weight:
 +
** 338.313   
 
* Synonym(s):
 
* Synonym(s):
** Esi_0165_0035
+
** 4-MU-glucoside
** Esi0165_0035
+
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[ATPASE-RXN]]
+
* [[RXN-10769]]
** [[pantograph]]-[[aragem]]
+
== Reaction(s) known to produce the compound ==
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=Esi_0165_0035|Esi0165_0035}}
+
* DRUGBANK : DB02639
{{#set: reaction associated=ATPASE-RXN}}
+
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=2733779 2733779]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.2015550.html 2015550]
 +
{{#set: smiles=CC3(C2(C=CC(OC1(OC(CO)C(O)C(O)C(O)1))=CC=2OC(=O)C=3))}}
 +
{{#set: inchi key=InChIKey=YUDPTGPSBJVHCN-YMILTQATSA-N}}
 +
{{#set: common name=4-methylumbelliferyl glucoside}}
 +
{{#set: molecular weight=338.313    }}
 +
{{#set: common name=4-MU-glucoside}}
 +
{{#set: consumed by=RXN-10769}}

Revision as of 21:48, 17 March 2018

Metabolite CPD-11641

  • smiles:
    • CC3(C2(C=CC(OC1(OC(CO)C(O)C(O)C(O)1))=CC=2OC(=O)C=3))
  • inchi key:
    • InChIKey=YUDPTGPSBJVHCN-YMILTQATSA-N
  • common name:
    • 4-methylumbelliferyl glucoside
  • molecular weight:
    • 338.313
  • Synonym(s):
    • 4-MU-glucoside

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links