|
|
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=6PFRUCTPHOS-RXN 6PFRUCTPHOS-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-641 CPD-641] == |
− | * direction: | + | * smiles: |
− | ** LEFT-TO-RIGHT | + | ** CC(O)(CCOP(=O)([O-])OP([O-])([O-])=O)CC(=O)[O-] |
| + | * inchi key: |
| + | ** InChIKey=SIGQQUBJQXSAMW-ZCFIWIBFSA-J |
| * common name: | | * common name: |
− | ** 6-phosphofructokinase | + | ** (R)-mevalonate diphosphate |
− | * ec number: | + | * molecular weight: |
− | ** [http://enzyme.expasy.org/EC/2.7.1.11 EC-2.7.1.11] | + | ** 304.087 |
| * Synonym(s): | | * Synonym(s): |
| + | ** mevalonate-5-PP |
| + | ** (R)-5-diphosphomevalonate |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | * [[DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN]] |
− | ** 1 [[FRUCTOSE-6P]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[FRUCTOSE-16-DIPHOSPHATE]][c] '''+''' 1 [[ADP]][c]
| + | == Reaction(s) known to produce the compound == |
− | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
− | ** 1 β-D-fructofuranose 6-phosphate[c] '''+''' 1 ATP[c] '''=>''' 1 H+[c] '''+''' 1 fructose 1,6-bisphosphate[c] '''+''' 1 ADP[c]
| + | * [[PHOSPHOMEVALONATE-KINASE-RXN]] |
− | | + | |
− | == Genes associated with this reaction == | + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Ec-22_000070]] | + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***GO-TERM
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | * [[Ec-12_002540]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***GO-TERM
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | * [[Ec-14_003880]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***GO-TERM
| + | |
− | == Pathways == | + | |
− | * [[PWY-1042]], glycolysis IV (plant cytosol): [http://metacyc.org/META/NEW-IMAGE?object=PWY-1042 PWY-1042]
| + | |
− | ** '''8''' reactions found over '''10''' reactions in the full pathway
| + | |
− | * [[GLYCOLYSIS]], glycolysis I (from glucose 6-phosphate): [http://metacyc.org/META/NEW-IMAGE?object=GLYCOLYSIS GLYCOLYSIS]
| + | |
− | ** '''12''' reactions found over '''12''' reactions in the full pathway
| + | |
− | * [[PWY-7385]], 1,3-propanediol biosynthesis (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7385 PWY-7385]
| + | |
− | ** '''5''' reactions found over '''9''' reactions in the full pathway
| + | |
− | * [[PWY-1861]], formaldehyde assimilation II (RuMP Cycle): [http://metacyc.org/META/NEW-IMAGE?object=PWY-1861 PWY-1861]
| + | |
− | ** '''7''' reactions found over '''9''' reactions in the full pathway
| + | |
− | * [[ANAGLYCOLYSIS-PWY]], glycolysis III (from glucose): [http://metacyc.org/META/NEW-IMAGE?object=ANAGLYCOLYSIS-PWY ANAGLYCOLYSIS-PWY]
| + | |
− | ** '''10''' reactions found over '''10''' reactions in the full pathway
| + | |
− | * [[PWY-5484]], glycolysis II (from fructose 6-phosphate): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5484 PWY-5484] | + | |
− | ** '''11''' reactions found over '''11''' reactions in the full pathway
| + | |
− | == Reconstruction information ==
| + | |
− | * [[orthology]]:
| + | |
− | ** [[pantograph]]:
| + | |
− | *** [[aragem]]
| + | |
− | * [[annotation]]:
| + | |
− | ** [[pathwaytools]]:
| + | |
− | *** [[esiliculosus_genome]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * CAS : 4872-34-8 |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=16109 16109]
| + | * PUBCHEM: |
− | * LIGAND-RXN:
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=24916915 24916915] |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R00756 R00756]
| + | * CHEBI: |
− | * UNIPROT: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57557 57557] |
− | ** [http://www.uniprot.org/uniprot/Q7M3F7 Q7M3F7] | + | * LIGAND-CPD: |
− | ** [http://www.uniprot.org/uniprot/Q7M4J2 Q7M4J2]
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C01143 C01143] |
− | ** [http://www.uniprot.org/uniprot/P12382 P12382]
| + | * HMDB : HMDB01090 |
− | ** [http://www.uniprot.org/uniprot/Q27665 Q27665] | + | {{#set: smiles=CC(O)(CCOP(=O)([O-])OP([O-])([O-])=O)CC(=O)[O-]}} |
− | ** [http://www.uniprot.org/uniprot/P52034 P52034] | + | {{#set: inchi key=InChIKey=SIGQQUBJQXSAMW-ZCFIWIBFSA-J}} |
− | ** [http://www.uniprot.org/uniprot/Q7M4K9 Q7M4K9]
| + | {{#set: common name=(R)-mevalonate diphosphate}} |
− | ** [http://www.uniprot.org/uniprot/P43863 P43863]
| + | {{#set: molecular weight=304.087 }} |
− | ** [http://www.uniprot.org/uniprot/P20275 P20275] | + | {{#set: common name=mevalonate-5-PP|(R)-5-diphosphomevalonate}} |
− | ** [http://www.uniprot.org/uniprot/P47457 P47457] | + | {{#set: consumed by=DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN}} |
− | ** [http://www.uniprot.org/uniprot/Q01813 Q01813] | + | {{#set: reversible reaction associated=PHOSPHOMEVALONATE-KINASE-RXN}} |
− | ** [http://www.uniprot.org/uniprot/Q07636 Q07636]
| + | |
− | ** [http://www.uniprot.org/uniprot/P16861 P16861]
| + | |
− | ** [http://www.uniprot.org/uniprot/P16862 P16862]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00512 P00512]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0A796 P0A796]
| + | |
− | ** [http://www.uniprot.org/uniprot/P06999 P06999]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08237 P08237]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00511 P00511]
| + | |
− | ** [http://www.uniprot.org/uniprot/P70927 P70927]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M3F5 Q7M3F5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9TWY0 Q9TWY0]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30835 P30835]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q03215 Q03215]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q03216 Q03216]
| + | |
− | ** [http://www.uniprot.org/uniprot/P80019 P80019]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59214 Q59214]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q27705 Q27705]
| + | |
− | ** [http://www.uniprot.org/uniprot/P75476 P75476]
| + | |
− | ** [http://www.uniprot.org/uniprot/P72830 P72830]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q55988 Q55988]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q49084 Q49084]
| + | |
− | ** [http://www.uniprot.org/uniprot/O08333 O08333]
| + | |
− | {{#set: direction=LEFT-TO-RIGHT}} | + | |
− | {{#set: common name=6-phosphofructokinase}} | + | |
− | {{#set: ec number=EC-2.7.1.11}} | + | |
− | {{#set: gene associated=Ec-22_000070|Ec-12_002540|Ec-14_003880}} | + | |
− | {{#set: in pathway=PWY-1042|GLYCOLYSIS|PWY-7385|PWY-1861|ANAGLYCOLYSIS-PWY|PWY-5484}} | + | |
− | {{#set: reconstruction category=orthology}} | + | |
− | {{#set: reconstruction tool=pantograph}}
| + | |
− | {{#set: reconstruction source=aragem}}
| + | |
− | {{#set: reconstruction category=annotation}}
| + | |
− | {{#set: reconstruction tool=pathwaytools}}
| + | |
− | {{#set: reconstruction source=esiliculosus_genome}}
| + | |