Difference between revisions of "3.2.1.106-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HYDRPHENYLAC-CPD HYDRPHENYLAC-CPD] == * smiles: ** [CH](=O)CC1(C=CC(O)=CC=1) * inchi key: ** In...") |
(Created page with "Category:Gene == Gene Ec-11_002820 == * left end position: ** 2976247 * transcription direction: ** POSITIVE * right end position: ** 2983203 * centisome position: ** 47.3...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-11_002820 == |
− | * | + | * left end position: |
− | ** | + | ** 2976247 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 2983203 |
− | * | + | * centisome position: |
− | ** | + | ** 47.319695 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0048_0062 |
+ | ** Esi0048_0062 | ||
+ | ** IGPS | ||
− | == | + | == Reactions associated == |
− | + | * [[IGPSYN-RXN]] | |
− | * [[RXN- | + | ** esiliculosus_genome |
− | == | + | ***ec-number |
+ | ** [[pantograph]]-[[aragem]] | ||
+ | == Pathways associated == | ||
+ | * [[TRPSYN-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2976247}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=2983203}} | |
− | + | {{#set: centisome position=47.319695 }} | |
− | + | {{#set: common name=Esi_0048_0062|Esi0048_0062|IGPS}} | |
− | + | {{#set: reaction associated=IGPSYN-RXN}} | |
− | + | {{#set: pathway associated=TRPSYN-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 21:49, 17 March 2018
Gene Ec-11_002820
- left end position:
- 2976247
- transcription direction:
- POSITIVE
- right end position:
- 2983203
- centisome position:
- 47.319695
- Synonym(s):
- Esi_0048_0062
- Esi0048_0062
- IGPS
Reactions associated
- IGPSYN-RXN
- esiliculosus_genome
- ec-number
- pantograph-aragem
- esiliculosus_genome