Difference between revisions of "Ec-19 005250"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-14_006780 == * left end position: ** 6269432 * transcription direction: ** NEGATIVE * right end position: ** 6276280 * centisome position: ** 95.5...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15616 CPD-15616] == * smiles: ** C(O)C(=O)C(O)C(O)C(O)CO * inchi key: ** InChIKey=BJHIKXHVC...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15616 CPD-15616] == |
− | * | + | * smiles: |
− | ** | + | ** C(O)C(=O)C(O)C(O)C(O)CO |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=BJHIKXHVCXFQLS-OTWZMJIISA-N |
− | * | + | * common name: |
− | ** | + | ** keto-L-sorbose |
− | * | + | * molecular weight: |
− | ** | + | ** 180.157 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[RXN- | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-14811]] | |
− | * [[ | + | * [[L-IDITOL-2-DEHYDROGENASE-RXN]] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * PUBCHEM: | |
− | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6904 6904] | |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=13172 13172] |
− | {{#set: common name= | + | * METABOLIGHTS : MTBLC13172 |
− | {{#set: | + | {{#set: smiles=C(O)C(=O)C(O)C(O)C(O)CO}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=BJHIKXHVCXFQLS-OTWZMJIISA-N}} |
+ | {{#set: common name=keto-L-sorbose}} | ||
+ | {{#set: molecular weight=180.157 }} | ||
+ | {{#set: reversible reaction associated=RXN-14811|L-IDITOL-2-DEHYDROGENASE-RXN}} |
Revision as of 22:49, 17 March 2018
Contents
Metabolite CPD-15616
- smiles:
- C(O)C(=O)C(O)C(O)C(O)CO
- inchi key:
- InChIKey=BJHIKXHVCXFQLS-OTWZMJIISA-N
- common name:
- keto-L-sorbose
- molecular weight:
- 180.157
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links