Difference between revisions of "CD-2S-SP-Complex"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-11_003690 == * left end position: ** 3724306 * transcription direction: ** POSITIVE * right end position: ** 3733617 * centisome position: ** 59.2...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-D-LACTONE GLC-D-LACTONE] == * smiles: ** C(O)C1(OC(C(C(C1O)O)O)=O) * inchi key: ** InChIKey...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-D-LACTONE GLC-D-LACTONE] == |
− | * | + | * smiles: |
− | ** | + | ** C(O)C1(OC(C(C(C1O)O)O)=O) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=PHOQVHQSTUBQQK-SQOUGZDYSA-N |
− | * | + | * common name: |
− | ** | + | ** D-glucono-1,5-lactone |
− | * | + | * molecular weight: |
− | ** | + | ** 178.141 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-one |
− | ** | + | ** gluconolactone |
+ | ** glucono-1,5-lactone | ||
+ | ** 1,5-gluconolactone | ||
+ | ** D-gluconolactone | ||
+ | ** glucono-δ-lactone | ||
+ | ** δ-gluconolactone | ||
+ | ** D-glucono-δ-lactone | ||
+ | ** gluconic lactone | ||
+ | ** gluconic acid lactone | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[GLUCONOLACT-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | * [[RXN-11334]] |
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 90-80-2 |
− | {{#set: | + | * DRUGBANK : DB04564 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7027 7027] |
− | {{#set: common name= | + | * HMDB : HMDB00150 |
− | {{#set: reaction associated= | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00198 C00198] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.6760.html 6760] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16217 16217] | ||
+ | {{#set: smiles=C(O)C1(OC(C(C(C1O)O)O)=O)}} | ||
+ | {{#set: inchi key=InChIKey=PHOQVHQSTUBQQK-SQOUGZDYSA-N}} | ||
+ | {{#set: common name=D-glucono-1,5-lactone}} | ||
+ | {{#set: molecular weight=178.141 }} | ||
+ | {{#set: common name=3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-one|gluconolactone|glucono-1,5-lactone|1,5-gluconolactone|D-gluconolactone|glucono-δ-lactone|δ-gluconolactone|D-glucono-δ-lactone|gluconic lactone|gluconic acid lactone}} | ||
+ | {{#set: consumed by=GLUCONOLACT-RXN}} | ||
+ | {{#set: reversible reaction associated=RXN-11334}} |
Revision as of 21:49, 17 March 2018
Contents
Metabolite GLC-D-LACTONE
- smiles:
- C(O)C1(OC(C(C(C1O)O)O)=O)
- inchi key:
- InChIKey=PHOQVHQSTUBQQK-SQOUGZDYSA-N
- common name:
- D-glucono-1,5-lactone
- molecular weight:
- 178.141
- Synonym(s):
- 3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-one
- gluconolactone
- glucono-1,5-lactone
- 1,5-gluconolactone
- D-gluconolactone
- glucono-δ-lactone
- δ-gluconolactone
- D-glucono-δ-lactone
- gluconic lactone
- gluconic acid lactone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 90-80-2
- DRUGBANK : DB04564
- PUBCHEM:
- HMDB : HMDB00150
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI: