Difference between revisions of "Ec-13 000360"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-20_000700 == * left end position: ** 665802 * transcription direction: ** POSITIVE * right end position: ** 669674 * centisome position: ** 12.912...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-120 CPD1F-120] == * smiles: ** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-]...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-20_000700 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-120 CPD1F-120] ==
−
* left end position:
+
* smiles:
−
** 665802
+
** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=QQRSSHFHXYSOMF-CXXOJBQZSA-L
−
* right end position:
+
* common name:
−
** 669674
+
** gibberellin A24
−
* centisome position:
+
* molecular weight:
−
** 12.912096    
+
** 344.407    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0058_0017
+
** GA24
−
** Esi0058_0017
+
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** esiliculosus_genome
+
* [[RXN1F-163]]
−
***go-term
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=665802}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246232 25246232]
−
{{#set: right end position=669674}}
+
* CHEBI:
−
{{#set: centisome position=12.912096   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=32906 32906]
−
{{#set: common name=Esi_0058_0017|Esi0058_0017}}
+
* LIGAND-CPD:
−
{{#set: reaction associated=TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C11861 C11861]
 +
* HMDB : HMDB37103
 +
{{#set: smiles=C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}}
 +
{{#set: inchi key=InChIKey=QQRSSHFHXYSOMF-CXXOJBQZSA-L}}
 +
{{#set: common name=gibberellin A24}}
 +
{{#set: molecular weight=344.407   }}
 +
{{#set: common name=GA24}}
 +
{{#set: produced by=RXN1F-163}}

Revision as of 21:49, 17 March 2018

Metabolite CPD1F-120

  • smiles:
    • C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
  • inchi key:
    • InChIKey=QQRSSHFHXYSOMF-CXXOJBQZSA-L
  • common name:
    • gibberellin A24
  • molecular weight:
    • 344.407
  • Synonym(s):
    • GA24

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-13_000360&oldid=14622"