Difference between revisions of "CREATINE-KINASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-D-LACTONE GLC-D-LACTONE] == * smiles: ** C(O)C1(OC(C(C(C1O)O)O)=O) * inchi key: ** InChIKey...")
 
(Created page with "Category:Gene == Gene Ec-26_006010 == * left end position: ** 6071767 * transcription direction: ** NEGATIVE * right end position: ** 6075984 * centisome position: ** 92.2...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-D-LACTONE GLC-D-LACTONE] ==
+
== Gene Ec-26_006010 ==
−
* smiles:
+
* left end position:
−
** C(O)C1(OC(C(C(C1O)O)O)=O)
+
** 6071767
−
* inchi key:
+
* transcription direction:
−
** InChIKey=PHOQVHQSTUBQQK-SQOUGZDYSA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** D-glucono-1,5-lactone
+
** 6075984
−
* molecular weight:
+
* centisome position:
−
** 178.141    
+
** 92.22917    
 
* Synonym(s):
 
* Synonym(s):
−
** 3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-one
+
** Esi_0059_0058
−
** gluconolactone
+
** Esi0059_0058
−
** glucono-1,5-lactone
+
−
** 1,5-gluconolactone
+
−
** D-gluconolactone
+
−
** glucono-δ-lactone
+
−
** δ-gluconolactone
+
−
** D-glucono-δ-lactone
+
−
** gluconic lactone
+
−
** gluconic acid lactone
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[GLUCONOLACT-RXN]]
+
* [[CERAMIDASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** esiliculosus_genome
−
== Reaction(s) of unknown directionality ==
+
***automated-name-match
−
* [[RXN-11334]]
+
* [[CERAMIDASE-YEAST-RXN]]
 +
** esiliculosus_genome
 +
***automated-name-match
 +
* [[RXN-11375]]
 +
** esiliculosus_genome
 +
***automated-name-match
 +
* [[RXN-13733]]
 +
** esiliculosus_genome
 +
***automated-name-match
 +
* [[RXN-646]]
 +
** [[pantograph]]-[[aragem]]
 +
== Pathways associated ==
 +
* [[PWY3DJ-11470]]
 +
* [[PWY-7128]]
 +
* [[PWY-5033]]
 +
* [[PWY-6993]]
 +
* [[PWY-722]]
 +
* [[PWY-6483]]
 +
* [[PWY-7119]]
 +
* [[PWY66-388]]
 
== External links  ==
 
== External links  ==
−
* CAS : 90-80-2
+
{{#set: left end position=6071767}}
−
* DRUGBANK : DB04564
+
{{#set: transcription direction=NEGATIVE}}
−
* PUBCHEM:
+
{{#set: right end position=6075984}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7027 7027]
+
{{#set: centisome position=92.22917   }}
−
* HMDB : HMDB00150
+
{{#set: common name=Esi_0059_0058|Esi0059_0058}}
−
* LIGAND-CPD:
+
{{#set: reaction associated=CERAMIDASE-RXN|CERAMIDASE-YEAST-RXN|RXN-11375|RXN-13733|RXN-646}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00198 C00198]
+
{{#set: pathway associated=PWY3DJ-11470|PWY-7128|PWY-5033|PWY-6993|PWY-722|PWY-6483|PWY-7119|PWY66-388}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.6760.html 6760]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16217 16217]
+
−
{{#set: smiles=C(O)C1(OC(C(C(C1O)O)O)=O)}}
+
−
{{#set: inchi key=InChIKey=PHOQVHQSTUBQQK-SQOUGZDYSA-N}}
+
−
{{#set: common name=D-glucono-1,5-lactone}}
+
−
{{#set: molecular weight=178.141   }}
+
−
{{#set: common name=3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-one|gluconolactone|glucono-1,5-lactone|1,5-gluconolactone|D-gluconolactone|glucono-δ-lactone|δ-gluconolactone|D-glucono-δ-lactone|gluconic lactone|gluconic acid lactone}}
+
−
{{#set: consumed by=GLUCONOLACT-RXN}}
+
−
{{#set: consumed or produced by=RXN-11334}}
+

Revision as of 21:50, 17 March 2018

Gene Ec-26_006010

  • left end position:
    • 6071767
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 6075984
  • centisome position:
    • 92.22917
  • Synonym(s):
    • Esi_0059_0058
    • Esi0059_0058

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CREATINE-KINASE-RXN&oldid=14647"