Difference between revisions of "Ec-18 003420"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-17_003950 == * left end position: ** 4172425 * transcription direction: ** NEGATIVE * right end position: ** 4213173 * centisome position: ** 86.9...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-134 CPD1F-134] == * smiles: ** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C))...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Ec-17_003950 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-134 CPD1F-134] ==
* left end position:
+
* smiles:
** 4172425
+
** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O)))
* transcription direction:
+
* inchi key:
** NEGATIVE
+
** InChIKey=MHVYWTXXZIFXDT-PKZSZHAESA-M
* right end position:
+
* common name:
** 4213173
+
** gibberellin A9
* centisome position:
+
* molecular weight:
** 86.962715    
+
** 315.388    
 
* Synonym(s):
 
* Synonym(s):
** Esi_0445_0006
+
** C19-GAs
** Esi0445_0006
+
** closed lactone gibberellin skeleton
** Possible CDPK
+
** C19 skeleton
 +
** C19-GA skeleton
 +
** C19-gibberellin skeleton
 +
** GA9
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[PROTEIN-KINASE-RXN]]
+
* [[RXN1F-165]]
** esiliculosus_genome
+
* [[RXN-171]]
***ec-number
+
== Reaction(s) known to produce the compound ==
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: left end position=4172425}}
+
* PUBCHEM:
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244370 25244370]
{{#set: right end position=4213173}}
+
* CHEBI:
{{#set: centisome position=86.962715   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73255 73255]
{{#set: common name=Esi_0445_0006|Esi0445_0006|Possible CDPK}}
+
* LIGAND-CPD:
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C11863 C11863]
 +
{{#set: smiles=C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O)))}}
 +
{{#set: inchi key=InChIKey=MHVYWTXXZIFXDT-PKZSZHAESA-M}}
 +
{{#set: common name=gibberellin A9}}
 +
{{#set: molecular weight=315.388   }}
 +
{{#set: common name=C19-GAs|closed lactone gibberellin skeleton|C19 skeleton|C19-GA skeleton|C19-gibberellin skeleton|GA9}}
 +
{{#set: consumed by=RXN1F-165|RXN-171}}

Revision as of 21:50, 17 March 2018

Metabolite CPD1F-134

  • smiles:
    • C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O)))
  • inchi key:
    • InChIKey=MHVYWTXXZIFXDT-PKZSZHAESA-M
  • common name:
    • gibberellin A9
  • molecular weight:
    • 315.388
  • Synonym(s):
    • C19-GAs
    • closed lactone gibberellin skeleton
    • C19 skeleton
    • C19-GA skeleton
    • C19-gibberellin skeleton
    • GA9

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O)))" cannot be used as a page name in this wiki.