Difference between revisions of "Ec-05 004840"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14901 CPD-14901] == * smiles: ** CCC(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14139 RXN-14139] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14901 CPD-14901] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14139 RXN-14139] ==
−
* smiles:
+
* direction:
−
** CCC(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=YSKVBPGQYRAUQO-XCFYOIDPSA-N
+
** [http://enzyme.expasy.org/EC/3.6.1.19 EC-3.6.1.19]
−
* common name:
+
−
** poriferst-7-enol
+
−
* molecular weight:
+
−
** 414.713   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 22-dihydrochondrillasterol
 
−
** 24β-ethylcholest-7-en-3β-ol
 
−
** chondrillast-7-enol
 
−
** dihydrochondrillasterol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-13892]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[WATER]][c] '''+''' 1 [[UTP]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[UMP]][c] '''+''' 1 [[PPI]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 H2O[c] '''+''' 1 UTP[c] '''=>''' 1 H+[c] '''+''' 1 UMP[c] '''+''' 1 diphosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Ec-13_002810]]
 +
** [[pantograph]]-[[aragem]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* CAS : 18525-35-4
+
* RHEA:
−
* PUBCHEM:
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=29398 29398]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12315364 12315364]
+
* LIGAND-RXN:
−
{{#set: smiles=CCC(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
** [http://www.genome.jp/dbget-bin/www_bget?R00662 R00662]
−
{{#set: inchi key=InChIKey=YSKVBPGQYRAUQO-XCFYOIDPSA-N}}
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: common name=poriferst-7-enol}}
+
{{#set: ec number=EC-3.6.1.19}}
−
{{#set: molecular weight=414.713    }}
+
{{#set: gene associated=Ec-13_002810}}
−
{{#set: common name=22-dihydrochondrillasterol|24β-ethylcholest-7-en-3β-ol|chondrillast-7-enol|dihydrochondrillasterol}}
+
{{#set: in pathway=}}
−
{{#set: consumed by=RXN-13892}}
+
{{#set: reconstruction category=orthology}}
 +
{{#set: reconstruction source=orthology-aragem}}
 +
{{#set: reconstruction tool=pantograph}}

Revision as of 21:50, 17 March 2018

Reaction RXN-14139

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 H2O[c] + 1 UTP[c] => 1 H+[c] + 1 UMP[c] + 1 diphosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-05_004840&oldid=14676"